The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-chloro-N-(5-((4-hydroxy-3-(4-methoxyphenyl)-2-oxocyclopent-3-en-1-yl)methyl)-1,2,3,4-tetrahydronaphthalen-2-yl)benzenesulfonamide ID: ALA3354616
PubChem CID: 117631354
Max Phase: Preclinical
Molecular Formula: C29H28ClNO5S
Molecular Weight: 538.07
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C2=C(O)CC(Cc3cccc4c3CCC(NS(=O)(=O)c3ccc(Cl)cc3)C4)C2=O)cc1
Standard InChI: InChI=1S/C29H28ClNO5S/c1-36-24-10-5-18(6-11-24)28-27(32)17-21(29(28)33)15-19-3-2-4-20-16-23(9-14-26(19)20)31-37(34,35)25-12-7-22(30)8-13-25/h2-8,10-13,21,23,31-32H,9,14-17H2,1H3
Standard InChI Key: BWMYVOPYHFCEOO-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
23.6222 -14.2565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.2612 -15.5741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4613 -17.0215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1725 -16.3309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9317 -15.5452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0469 -15.3333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9921 -16.3497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6073 -15.0775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3881 -12.6822 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9688 -11.8665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2581 -11.4580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9315 -13.0899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0997 -13.0927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2241 -12.6824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8357 -11.4612 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
16.5530 -12.6961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0997 -13.9136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2643 -13.1026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5479 -11.8709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5180 -13.9118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6786 -13.0969 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.8118 -12.6760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9338 -13.9122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8118 -14.3178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2250 -14.3189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5196 -13.0927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2699 -13.8026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0870 -13.8052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9673 -12.6865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2243 -15.1360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6476 -15.8947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4327 -15.6544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6176 -14.8528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0112 -14.2918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2285 -14.5351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3985 -14.6123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.9974 -15.1684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 7 1 0
8 5 1 0
7 2 2 0
5 4 1 0
2 6 1 0
2 8 1 0
8 1 2 0
7 3 1 0
13 17 1 0
16 18 2 0
19 16 1 0
27 21 2 0
17 24 1 0
9 21 1 0
29 10 2 0
13 22 1 0
26 22 1 0
24 20 1 0
11 19 2 0
14 26 1 0
23 12 1 0
13 9 1 0
25 23 2 0
19 15 1 0
21 28 2 0
18 29 1 0
21 29 1 0
12 14 2 0
20 25 1 0
10 11 1 0
26 20 2 0
25 30 1 0
30 5 1 0
6 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 6 1 0
33 36 1 0
36 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 538.07Molecular Weight (Monoisotopic): 537.1377AlogP: 5.29#Rotatable Bonds: 7Polar Surface Area: 92.70Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.56CX Basic pKa: ┄CX LogP: 5.84CX LogD: 5.81Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.43Np Likeness Score: -0.28
References 1. Wang X, Liu L, Huang L, Herbst-Robinson K, Cornec AS, James MJ, Sugiyama S, Bassetto M, Brancale A, Trojanowski JQ, Lee VM, Smith AB, Brunden KR, Ballatore C.. (2014) Potent, long-acting cyclopentane-1,3-Dione thromboxane (A2)-receptor antagonists., 5 (9): [PMID:25221659 ] [10.1021/ml5002085 ]