N-(5-((3-benzyl-4-hydroxy-2-oxocyclopent-3-en-1-yl)methyl)-1,2,3,4-tetrahydronaphthalen-2-yl)-4-chlorobenzenesulfonamide

ID: ALA3354619

PubChem CID: 117630458

Max Phase: Preclinical

Molecular Formula: C29H28ClNO4S

Molecular Weight: 522.07

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1C(Cc2ccccc2)=C(O)CC1Cc1cccc2c1CCC(NS(=O)(=O)c1ccc(Cl)cc1)C2

Standard InChI:  InChI=1S/C29H28ClNO4S/c30-23-9-12-25(13-10-23)36(34,35)31-24-11-14-26-20(7-4-8-21(26)17-24)16-22-18-28(32)27(29(22)33)15-19-5-2-1-3-6-19/h1-10,12-13,22,24,31-32H,11,14-18H2

Standard InChI Key:  BISWQQVGNDSUFN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   21.0385  -22.4615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.6780  -23.7787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8776  -25.2264    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5888  -24.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3481  -23.7501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3878  -23.3646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4085  -24.5547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0237  -23.2824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8044  -20.8872    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3852  -20.0715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6745  -19.6630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3479  -21.2948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5160  -21.2977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6404  -20.8874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2521  -19.6661    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   13.9694  -20.9010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5160  -22.1185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6806  -21.3076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9643  -20.0758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9344  -22.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0950  -21.3018    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.2281  -20.8809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3502  -22.1171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2281  -22.5228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6413  -22.5238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9360  -21.2977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6862  -22.0076    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5034  -22.0102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3837  -20.8914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6407  -23.3410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0974  -23.7700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0969  -24.5870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8056  -24.9923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5125  -24.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5061  -23.7590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7968  -23.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  7  1  0
  8  5  1  0
  7  2  2  0
  5  4  1  0
  2  6  1  0
  2  8  1  0
  8  1  2  0
  7  3  1  0
 13 17  1  0
 16 18  2  0
 19 16  1  0
 27 21  2  0
 17 24  1  0
  9 21  1  0
 29 10  2  0
 13 22  1  0
 26 22  1  0
 24 20  1  0
 11 19  2  0
 14 26  1  0
 23 12  1  0
 13  9  1  0
 25 23  2  0
 19 15  1  0
 21 28  2  0
 18 29  1  0
 21 29  1  0
 12 14  2  0
 20 25  1  0
 10 11  1  0
 26 20  2  0
 25 30  1  0
 30  5  1  0
  6 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
M  END

Associated Targets(Human)

TBXA2R Tclin Thromboxane A2 receptor (5717 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 522.07Molecular Weight (Monoisotopic): 521.1428AlogP: 5.36#Rotatable Bonds: 7
Polar Surface Area: 83.47Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.50CX Basic pKa: CX LogP: 6.30CX LogD: 6.27
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.44Np Likeness Score: -0.21

References

1. Wang X, Liu L, Huang L, Herbst-Robinson K, Cornec AS, James MJ, Sugiyama S, Bassetto M, Brancale A, Trojanowski JQ, Lee VM, Smith AB, Brunden KR, Ballatore C..  (2014)  Potent, long-acting cyclopentane-1,3-Dione thromboxane (A2)-receptor antagonists.,  (9): [PMID:25221659] [10.1021/ml5002085]

Source