The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-(4-Chlorophenyl)-5-(thiophen-2-yl)-4,5-dihydro-1H-pyrazol-1-yl)-4-(4-(trifluoromethyl)phenyl)thiazole ID: ALA3355898
PubChem CID: 101886904
Max Phase: Preclinical
Molecular Formula: C23H15ClF3N3S2
Molecular Weight: 489.98
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: FC(F)(F)c1ccc(-c2csc(N3N=C(c4ccc(Cl)cc4)CC3c3cccs3)n2)cc1
Standard InChI: InChI=1S/C23H15ClF3N3S2/c24-17-9-5-14(6-10-17)18-12-20(21-2-1-11-31-21)30(29-18)22-28-19(13-32-22)15-3-7-16(8-4-15)23(25,26)27/h1-11,13,20H,12H2
Standard InChI Key: UOTXCQFXGRGQEU-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
14.2798 -14.6955 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.2798 -13.8783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0529 -13.6237 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5372 -14.2869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0529 -14.9461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3544 -14.2869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7630 -13.5778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5801 -13.5778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9887 -14.2869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5801 -14.9919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7630 -14.9919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8059 -14.2869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6231 -14.2869 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.2145 -14.9919 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.2145 -13.5778 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.6165 -13.3941 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8393 -13.6487 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3592 -12.9855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8393 -12.3263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6165 -12.5769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2798 -12.1009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2798 -11.2837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0529 -11.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5372 -11.6923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0529 -12.3514 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.5420 -12.9855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1334 -13.6946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3162 -13.6946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9076 -12.9855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3162 -12.2805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1334 -12.2805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0904 -12.9855 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
1 5 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
6 11 2 0
12 13 1 0
12 14 1 0
12 15 1 0
9 12 1 0
4 6 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
16 20 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
21 25 1 0
20 21 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
26 31 2 0
29 32 1 0
18 26 1 0
2 16 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 489.98Molecular Weight (Monoisotopic): 489.0348AlogP: 7.90#Rotatable Bonds: 4Polar Surface Area: 28.49Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.90CX LogP: 8.19CX LogD: 8.19Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.29Np Likeness Score: -2.09
References 1. Zhao MY, Yin Y, Yu XW, Sangani CB, Wang SF, Lu AM, Yang LF, Lv PC, Jiang MG, Zhu HL.. (2015) Synthesis, biological evaluation and 3D-QSAR study of novel 4,5-dihydro-1H-pyrazole thiazole derivatives as BRAF(V⁶⁰⁰E) inhibitors., 23 (1): [PMID:25496804 ] [10.1016/j.bmc.2014.11.029 ]