The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-[(Hexahydro-1H-pyrrolizin-7a-yl)methylimino]-N,5-diphenyl-3,5-dihydrophenazin-2-amine hydrochloride ID: ALA3356375
PubChem CID: 118721487
Max Phase: Preclinical
Molecular Formula: C32H32ClN5
Molecular Weight: 485.64
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cl.c1ccc(Nc2cc3nc4ccccc4n(-c4ccccc4)c-3c/c2=N/CC23CCCN2CCC3)cc1
Standard InChI: InChI=1S/C32H31N5.ClH/c1-3-11-24(12-4-1)34-28-21-29-31(22-27(28)33-23-32-17-9-19-36(32)20-10-18-32)37(25-13-5-2-6-14-25)30-16-8-7-15-26(30)35-29;/h1-8,11-16,21-22,34H,9-10,17-20,23H2;1H/b33-27-;
Standard InChI Key: SEPNTJSAISMYIC-AIZXEQHCSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
8.3726 -7.2908 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.3333 -5.5510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6248 -5.1365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6294 -4.3073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3427 -3.9009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0553 -4.3153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7727 -3.9089 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4855 -4.3234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2029 -3.9170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9156 -4.3314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9109 -5.1606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1935 -5.5670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4809 -5.1526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7635 -5.5590 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0507 -5.1445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9074 -5.5429 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7773 -3.0839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0647 -2.6653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0693 -1.8403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7867 -1.4339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4993 -1.8483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4947 -2.6733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9028 -6.3679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6155 -6.7866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6108 -7.6116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8935 -8.0180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1808 -7.6035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1854 -6.7785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9167 -3.8928 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1993 -4.2993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7739 -3.4662 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9491 -2.6643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7701 -2.5790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1038 -3.3349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4866 -3.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3114 -4.6910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4903 -4.7722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1566 -4.0162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
8 13 2 0
13 14 1 0
14 15 2 0
6 15 1 0
2 15 1 0
3 16 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
17 22 2 0
7 17 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
23 28 2 0
16 23 1 0
29 30 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
31 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
31 38 1 0
30 35 1 0
4 29 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.64Molecular Weight (Monoisotopic): 485.2579AlogP: 6.40#Rotatable Bonds: 5Polar Surface Area: 45.45Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.62CX LogP: 6.14CX LogD: 3.92Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.29Np Likeness Score: -0.71
References 1. Barteselli A, Casagrande M, Basilico N, Parapini S, Rusconi CM, Tonelli M, Boido V, Taramelli D, Sparatore F, Sparatore A.. (2015) Clofazimine analogs with antileishmanial and antiplasmodial activity., 23 (1): [PMID:25497962 ] [10.1016/j.bmc.2014.11.028 ]