The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-({4-[(2,4-Diamino-pteridin-6-ylmethyl)-amino]-naphthalene-1-carbonyl}-amino)-pentanedioic acid ID: ALA335716
PubChem CID: 44354669
Max Phase: Preclinical
Molecular Formula: C23H22N8O5
Molecular Weight: 490.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc(N)c2nc(CNc3ccc(C(=O)NC(CCC(=O)O)C(=O)O)c4ccccc34)cnc2n1
Standard InChI: InChI=1S/C23H22N8O5/c24-19-18-20(31-23(25)30-19)27-10-11(28-18)9-26-15-6-5-14(12-3-1-2-4-13(12)15)21(34)29-16(22(35)36)7-8-17(32)33/h1-6,10,16,26H,7-9H2,(H,29,34)(H,32,33)(H,35,36)(H4,24,25,27,30,31)
Standard InChI Key: NXSOQESYOFTIRJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
0.0667 -3.9375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7792 -5.1792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4917 -3.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4917 -4.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7792 -3.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0667 -4.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1167 -2.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4042 -2.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2042 -3.5167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9750 -3.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7000 -3.1167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2125 -5.1750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1417 -3.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6250 -1.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4125 -2.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0042 -2.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7500 -2.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9250 -2.9167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9167 -3.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3667 -4.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1125 -1.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4167 -1.6875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1792 -2.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9500 -5.2417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7750 -2.7000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9250 -4.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6500 -5.1750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9917 -3.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7167 -3.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7792 -4.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9042 -1.4917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9500 -4.0667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3667 -4.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7167 -4.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9417 -5.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1125 -5.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 6 1 0
3 5 2 0
4 2 2 0
5 1 1 0
6 1 2 0
7 8 1 0
8 16 2 0
9 3 1 0
10 13 1 0
11 7 1 0
12 4 1 0
13 17 1 0
14 15 1 0
15 11 1 0
16 23 1 0
17 18 1 0
18 29 1 0
19 9 2 0
20 30 1 0
21 7 2 0
22 14 2 0
23 17 2 0
24 20 2 0
25 5 1 0
26 12 2 0
27 6 1 0
28 15 1 0
29 19 1 0
30 28 1 0
31 14 1 0
32 20 1 0
33 10 2 0
34 13 2 0
35 36 2 0
36 34 1 0
3 4 1 0
26 19 1 0
10 8 1 0
35 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 490.48Molecular Weight (Monoisotopic): 490.1713AlogP: 1.40#Rotatable Bonds: 9Polar Surface Area: 219.33Molecular Species: ACIDHBA: 10HBD: 6#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 8#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.53CX Basic pKa: 2.89CX LogP: 0.18CX LogD: -6.03Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.20Np Likeness Score: -0.47
References 1. Piper JR, Johnson CA, Maddry JA, Malik ND, McGuire JJ, Otter GM, Sirotnak FM.. (1993) Studies on analogues of classical antifolates bearing the naphthoyl group in place of benzoyl in the side chain., 36 (26): [PMID:8277497 ] [10.1021/jm00078a004 ]