(S)-4'-(azidomethyl)-N-(1-(cyanomethylamino)-1-oxo-3-phenylpropan-2-yl)biphenyl-4-carboxamide

ID: ALA3357959

PubChem CID: 118722552

Max Phase: Preclinical

Molecular Formula: C25H22N6O2

Molecular Weight: 438.49

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#CCNC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccc(-c2ccc(CN=[N+]=[N-])cc2)cc1

Standard InChI:  InChI=1S/C25H22N6O2/c26-14-15-28-25(33)23(16-18-4-2-1-3-5-18)30-24(32)22-12-10-21(11-13-22)20-8-6-19(7-9-20)17-29-31-27/h1-13,23H,15-17H2,(H,28,33)(H,30,32)/t23-/m0/s1

Standard InChI Key:  CLTXIOBPAVQPCG-QHCPKHFHSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   18.9951   -3.4421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7028   -3.0335    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9951   -4.2593    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4105   -3.4421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1183   -3.0335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8260   -3.4421    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.1183   -2.2163    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.5337   -3.0335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4105   -4.2593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2414   -3.4421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9458   -3.8488    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2910   -3.0335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2923   -2.2152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5855   -1.8067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8768   -2.2154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8794   -3.0368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5869   -3.4416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1685   -1.8077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1735   -0.9895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4666   -0.5810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7579   -0.9896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7605   -1.8110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4680   -2.2158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0516   -0.5779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3480   -0.9869    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.6390   -1.3944    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9271   -1.8028    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.1135   -4.6637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1150   -5.4850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8259   -5.8926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5358   -5.4799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5302   -4.6555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8188   -4.2517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  2  0
  6  8  1  0
  4  9  1  6
  9 28  1  0
  8 10  1  0
 10 11  3  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  1 12  1  0
 15 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 25 24  1  0
 21 24  1  0
 25 26  2  0
 26 27  2  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
M  CHG  2  26   1  27  -1
M  END

Alternative Forms

  1. Parent:

    ALA3357959

    ---

Associated Targets(non-human)

Papain (844 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 438.49Molecular Weight (Monoisotopic): 438.1804AlogP: 4.14#Rotatable Bonds: 9
Polar Surface Area: 130.75Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.98CX Basic pKa: CX LogP: 3.40CX LogD: 3.29
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.23Np Likeness Score: -0.59

References

1. Wammes AE, Hendriks TG, Amatdjais-Groenen HI, Wijdeven MA, van Hest JC, van Delft FL, Ritschel T, Rutjes FP..  (2014)  Influence of azide incorporation on binding affinity by small papain inhibitors.,  22  (20): [PMID:24972724] [10.1016/j.bmc.2014.06.001]

Source