The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-4'-(azidomethyl)-N-(1-(cyanomethylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl)biphenyl-4-carboxamide ID: ALA3357960
PubChem CID: 118722553
Max Phase: Preclinical
Molecular Formula: C25H22N6O3
Molecular Weight: 454.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N#CCNC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)c1ccc(-c2ccc(CN=[N+]=[N-])cc2)cc1
Standard InChI: InChI=1S/C25H22N6O3/c26-13-14-28-25(34)23(15-17-3-11-22(32)12-4-17)30-24(33)21-9-7-20(8-10-21)19-5-1-18(2-6-19)16-29-31-27/h1-12,23,32H,14-16H2,(H,28,34)(H,30,33)/t23-/m0/s1
Standard InChI Key: JSMXRFVWKYCAET-QHCPKHFHSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
9.4034 -10.5244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1112 -10.1158 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4034 -11.3416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8189 -10.5244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5266 -10.1158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2343 -10.5244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5266 -9.2986 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9420 -10.1158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8189 -11.3416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6497 -10.5244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3541 -10.9311 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5234 -11.7502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5221 -12.5685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2290 -12.9770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9377 -12.5683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9350 -11.7469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2276 -11.3421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6459 -12.9760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6993 -10.1159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7007 -9.2976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9938 -8.8891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2851 -9.2977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2877 -10.1191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9952 -10.5239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5769 -8.8901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5818 -8.0718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8749 -7.6633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1662 -8.0719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1688 -8.8933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8763 -9.2982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4599 -7.6602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7563 -8.0692 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0473 -8.4767 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3354 -8.8851 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
2 4 1 0
4 5 1 0
5 6 1 0
5 7 2 0
6 8 1 0
4 9 1 6
9 12 1 0
8 10 1 0
10 11 3 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
15 18 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
1 19 1 0
22 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
32 31 1 0
28 31 1 0
32 33 2 0
33 34 2 0
M CHG 2 33 1 34 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.49Molecular Weight (Monoisotopic): 454.1753AlogP: 3.85#Rotatable Bonds: 9Polar Surface Area: 150.98Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.50CX Basic pKa: ┄CX LogP: 3.10CX LogD: 2.98Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.19Np Likeness Score: -0.37
References 1. Wammes AE, Hendriks TG, Amatdjais-Groenen HI, Wijdeven MA, van Hest JC, van Delft FL, Ritschel T, Rutjes FP.. (2014) Influence of azide incorporation on binding affinity by small papain inhibitors., 22 (20): [PMID:24972724 ] [10.1016/j.bmc.2014.06.001 ]