(S)-4'-(azidomethyl)-N-(1-(cyanomethylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl)biphenyl-4-carboxamide

ID: ALA3357960

PubChem CID: 118722553

Max Phase: Preclinical

Molecular Formula: C25H22N6O3

Molecular Weight: 454.49

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#CCNC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)c1ccc(-c2ccc(CN=[N+]=[N-])cc2)cc1

Standard InChI:  InChI=1S/C25H22N6O3/c26-13-14-28-25(34)23(15-17-3-11-22(32)12-4-17)30-24(33)21-9-7-20(8-10-21)19-5-1-18(2-6-19)16-29-31-27/h1-12,23,32H,14-16H2,(H,28,34)(H,30,33)/t23-/m0/s1

Standard InChI Key:  JSMXRFVWKYCAET-QHCPKHFHSA-N

Molfile:  

     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
    9.4034  -10.5244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1112  -10.1158    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4034  -11.3416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8189  -10.5244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5266  -10.1158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2343  -10.5244    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5266   -9.2986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9420  -10.1158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8189  -11.3416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6497  -10.5244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3541  -10.9311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5234  -11.7502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5221  -12.5685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2290  -12.9770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9377  -12.5683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9350  -11.7469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2276  -11.3421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6459  -12.9760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6993  -10.1159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7007   -9.2976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9938   -8.8891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2851   -9.2977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2877  -10.1191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9952  -10.5239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5769   -8.8901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5818   -8.0718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8749   -7.6633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1662   -8.0719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1688   -8.8933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8763   -9.2982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4599   -7.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7563   -8.0692    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0473   -8.4767    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3354   -8.8851    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  2  0
  6  8  1  0
  4  9  1  6
  9 12  1  0
  8 10  1  0
 10 11  3  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 15 18  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
  1 19  1  0
 22 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 32 31  1  0
 28 31  1  0
 32 33  2  0
 33 34  2  0
M  CHG  2  33   1  34  -1
M  END

Alternative Forms

  1. Parent:

    ALA3357960

    ---

Associated Targets(non-human)

Papain (844 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 454.49Molecular Weight (Monoisotopic): 454.1753AlogP: 3.85#Rotatable Bonds: 9
Polar Surface Area: 150.98Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 9.50CX Basic pKa: CX LogP: 3.10CX LogD: 2.98
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.19Np Likeness Score: -0.37

References

1. Wammes AE, Hendriks TG, Amatdjais-Groenen HI, Wijdeven MA, van Hest JC, van Delft FL, Ritschel T, Rutjes FP..  (2014)  Influence of azide incorporation on binding affinity by small papain inhibitors.,  22  (20): [PMID:24972724] [10.1016/j.bmc.2014.06.001]

Source