The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-(6-morpholinobenzo[d]thiazol-2-yl)-2-(2-hydroxy-4-(4-methylbenzyloxy)benzylidene)hydrazinecarboxamide ID: ALA3357970
PubChem CID: 137007044
Max Phase: Preclinical
Molecular Formula: C27H27N5O4S
Molecular Weight: 517.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(COc2ccc(/C=N/NC(=O)Nc3nc4ccc(N5CCOCC5)cc4s3)c(O)c2)cc1
Standard InChI: InChI=1S/C27H27N5O4S/c1-18-2-4-19(5-3-18)17-36-22-8-6-20(24(33)15-22)16-28-31-26(34)30-27-29-23-9-7-21(14-25(23)37-27)32-10-12-35-13-11-32/h2-9,14-16,33H,10-13,17H2,1H3,(H2,29,30,31,34)/b28-16+
Standard InChI Key: VKAHONSLUMSLBE-LQKURTRISA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
6.9435 -11.1578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6402 -10.7398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9540 -11.9778 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3744 -11.9511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6694 -12.3745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3557 -11.1364 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4405 -6.0294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7878 -9.5869 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2618 -9.6442 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2697 -10.9764 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.2205 -6.7446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9710 -9.5918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7759 -11.1329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5585 -8.8880 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0615 -4.6046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4861 -10.7242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5669 -10.3004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1825 -7.4683 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9992 -7.4605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6584 -5.3171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0664 -9.9050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8436 -5.3203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7501 -10.3054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0501 -3.1907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4128 -8.1648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7741 -9.4965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3995 -6.7521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6332 -7.4493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6479 -3.9004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8269 -3.9091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0652 -10.7241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4275 -4.6179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0087 -8.8734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6237 -6.0354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2291 -8.1613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1919 -8.8783 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4812 -9.9014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6 4 1 0
5 4 1 0
1 3 1 0
2 1 1 0
6 2 1 0
3 5 1 0
30 32 2 0
23 17 1 0
36 33 2 0
19 18 1 0
34 7 1 0
13 16 2 0
17 12 1 0
12 8 1 0
29 24 1 0
7 22 1 0
23 9 2 0
21 31 2 0
11 34 1 0
12 14 2 0
16 10 1 0
15 29 2 0
20 15 1 0
9 37 1 0
28 11 2 0
31 13 1 0
8 36 1 0
22 20 2 0
26 21 1 0
37 16 1 0
10 23 1 0
35 28 1 0
19 25 1 0
33 25 1 0
25 35 2 0
32 22 1 0
29 30 1 0
11 27 1 0
37 26 2 0
27 19 2 0
31 6 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 517.61Molecular Weight (Monoisotopic): 517.1784AlogP: 4.88#Rotatable Bonds: 7Polar Surface Area: 108.31Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.42CX Basic pKa: 0.89CX LogP: 5.51CX LogD: 5.22Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.24Np Likeness Score: -1.92
References 1. Ma J, Chen D, Lu K, Wang L, Han X, Zhao Y, Gong P.. (2014) Design, synthesis, and structure-activity relationships of novel benzothiazole derivatives bearing the ortho-hydroxy N-carbamoylhydrazone moiety as potent antitumor agents., 86 [PMID:25171780 ] [10.1016/j.ejmech.2014.08.058 ]