The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-(6-morpholinobenzo[d]thiazol-2-yl)-2-(4-(2,4-dichlorobenzyloxy)-2-hydroxybenzylidene)hydrazinecarboxamide ID: ALA3357974
PubChem CID: 137007048
Max Phase: Preclinical
Molecular Formula: C26H23Cl2N5O4S
Molecular Weight: 572.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(N/N=C/c1ccc(OCc2ccc(Cl)cc2Cl)cc1O)Nc1nc2ccc(N3CCOCC3)cc2s1
Standard InChI: InChI=1S/C26H23Cl2N5O4S/c27-18-3-1-17(21(28)11-18)15-37-20-5-2-16(23(34)13-20)14-29-32-25(35)31-26-30-22-6-4-19(12-24(22)38-26)33-7-9-36-10-8-33/h1-6,11-14,34H,7-10,15H2,(H2,30,31,32,35)/b29-14+
Standard InChI Key: HMZPPGUUXBTWMR-IPPBACCNSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
18.3223 -11.7768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0190 -11.3589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3327 -12.5969 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7532 -12.5702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0482 -12.9936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7345 -11.7555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.8193 -6.6485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1666 -10.2060 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6406 -10.2633 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6484 -11.5955 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.5993 -7.3637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3498 -10.2109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1547 -11.7520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9373 -9.5071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.4402 -5.2237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8649 -11.3433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9457 -10.9195 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.5613 -8.0874 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.3780 -8.0796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0371 -5.9361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4451 -10.5241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2224 -5.9394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1289 -10.9244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7916 -8.7839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1528 -10.1156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7783 -7.3712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0120 -8.0684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0266 -4.5195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2056 -4.5282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4440 -11.3432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8062 -5.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3875 -9.4925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0025 -6.6545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.6078 -8.7804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5707 -9.4974 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8600 -10.5205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4502 -6.6413 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
30.4288 -3.8081 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6 4 1 0
5 4 1 0
1 3 1 0
2 1 1 0
6 2 1 0
3 5 1 0
29 31 2 0
23 17 1 0
35 32 2 0
19 18 1 0
33 7 1 0
13 16 2 0
17 12 1 0
12 8 1 0
7 22 1 0
23 9 2 0
21 30 2 0
11 33 1 0
12 14 2 0
16 10 1 0
15 28 2 0
20 15 1 0
9 36 1 0
27 11 2 0
30 13 1 0
8 35 1 0
22 20 2 0
25 21 1 0
36 16 1 0
10 23 1 0
34 27 1 0
19 24 1 0
32 24 1 0
24 34 2 0
31 22 1 0
28 29 1 0
11 26 1 0
36 25 2 0
26 19 2 0
30 6 1 0
20 37 1 0
28 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 572.47Molecular Weight (Monoisotopic): 571.0848AlogP: 5.88#Rotatable Bonds: 7Polar Surface Area: 108.31Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.42CX Basic pKa: 0.61CX LogP: 6.20CX LogD: 5.92Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.19Np Likeness Score: -2.11
References 1. Ma J, Chen D, Lu K, Wang L, Han X, Zhao Y, Gong P.. (2014) Design, synthesis, and structure-activity relationships of novel benzothiazole derivatives bearing the ortho-hydroxy N-carbamoylhydrazone moiety as potent antitumor agents., 86 [PMID:25171780 ] [10.1016/j.ejmech.2014.08.058 ]