2-hydroxy-3-((1R,4aR,4bS,10aR)-7-isopropyl-1,4a-dimethyltetradecahydrophenanthrene-1-carbonyloxy)-N,N,N-trimethylpropan-1-aminium

ID: ALA3358318

PubChem CID: 118722789

Max Phase: Preclinical

Molecular Formula: C26H48NO3+

Molecular Weight: 422.67

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)C1CC[C@H]2C(CC[C@@H]3[C@]2(C)CCC[C@@]3(C)C(=O)OCC(O)C[N+](C)(C)C)C1

Standard InChI:  InChI=1S/C26H48NO3/c1-18(2)19-9-11-22-20(15-19)10-12-23-25(22,3)13-8-14-26(23,4)24(29)30-17-21(28)16-27(5,6)7/h18-23,28H,8-17H2,1-7H3/q+1/t19?,20?,21?,22-,23+,25+,26+/m0/s1

Standard InChI Key:  ZWXGQGCKQDMPAM-QDYQWGSOSA-N

Molfile:  

     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   25.4402  -10.2397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4402  -11.0568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1455  -11.4613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1455   -9.8269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8508  -10.2397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8473  -11.0568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5494  -11.4662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2594  -11.0628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5563   -9.8318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2629  -10.2505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9748   -9.8501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9864   -9.0295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2798   -8.6108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5617   -9.0128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6992   -8.6299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4017   -9.0474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7096   -7.8128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5536  -12.1672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2616  -10.4708    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   26.8435   -9.4225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5493  -10.6482    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   26.1459  -12.8754    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.3708  -12.1661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.7803  -12.8733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5975  -12.8723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0070  -13.5795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0052  -12.1640    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.5993  -14.2877    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.5599  -12.0391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0088  -14.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7821  -14.2887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1848  -14.9901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5  9  1  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 12 15  1  0
 15 16  1  0
 15 17  1  0
  3 18  1  6
  6 19  1  6
  5 20  1  1
  9 21  1  6
 18 22  2  0
 18 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  0
 26 28  1  0
  3 29  1  0
 28 30  1  0
 28 31  1  0
 28 32  1  0
M  CHG  1  28   1
M  END

Alternative Forms

  1. Parent:

    ALA3358318

    ---

Associated Targets(non-human)

Trametes versicolor (86 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Gloeophyllum trabeum (56 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 422.67Molecular Weight (Monoisotopic): 422.3629AlogP: 4.89#Rotatable Bonds: 6
Polar Surface Area: 46.53Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.68CX Basic pKa: CX LogP: 1.14CX LogD: 1.14
Aromatic Rings: Heavy Atoms: 30QED Weighted: 0.49Np Likeness Score: 2.08

References

1. Wang H, Nguyen TT, Li S, Liang T, Zhang Y, Li J..  (2015)  Quantitative structure-activity relationship of antifungal activity of rosin derivatives.,  25  (2): [PMID:25466709] [10.1016/j.bmcl.2014.11.034]

Source