The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N,N-triethyl-2-hydroxy-3-((1R,4aR,4bS,10aR)-7-isopropyl-1,4a-dimethyltetradecahydrophenanthrene-1-carbonyloxy)propan-1-aminium ID: ALA3358319
PubChem CID: 118722790
Max Phase: Preclinical
Molecular Formula: C29H54NO3+
Molecular Weight: 464.76
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC[N+](CC)(CC)CC(O)COC(=O)[C@]1(C)CCC[C@@]2(C)[C@H]1CCC1CC(C(C)C)CC[C@@H]12
Standard InChI: InChI=1S/C29H54NO3/c1-8-30(9-2,10-3)19-24(31)20-33-27(32)29(7)17-11-16-28(6)25-14-12-22(21(4)5)18-23(25)13-15-26(28)29/h21-26,31H,8-20H2,1-7H3/q+1/t22?,23?,24?,25-,26+,28+,29+/m0/s1
Standard InChI Key: AEKZRHRRTOYWFU-WBDRKCIRSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
31.9076 -9.8930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9076 -10.7102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6129 -11.1146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6129 -9.4802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3182 -9.8930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3147 -10.7101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0168 -11.1195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7268 -10.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0237 -9.4851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7303 -9.9038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4422 -9.5034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4537 -8.6828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7471 -8.2641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0290 -8.6661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1666 -8.2832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8690 -8.7007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1769 -7.4661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0209 -11.8205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7289 -10.1241 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
33.3109 -9.0758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0166 -10.3016 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
32.6132 -12.5287 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.8381 -11.8194 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.2476 -12.5266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0648 -12.5256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4743 -13.2328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4725 -11.8174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.0666 -13.9410 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.0273 -11.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4761 -14.6482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2494 -13.9420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6522 -14.6434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8399 -13.2349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2933 -14.6472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8351 -14.6357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 1 0
5 9 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 10 1 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
12 15 1 0
15 16 1 0
15 17 1 0
3 18 1 6
6 19 1 6
5 20 1 1
9 21 1 6
18 22 2 0
18 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
25 27 1 0
26 28 1 0
3 29 1 0
28 30 1 0
28 31 1 0
28 32 1 0
31 33 1 0
30 34 1 0
32 35 1 0
M CHG 1 28 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.76Molecular Weight (Monoisotopic): 464.4098AlogP: 6.06#Rotatable Bonds: 9Polar Surface Area: 46.53Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.68CX Basic pKa: ┄CX LogP: 2.21CX LogD: 2.21Aromatic Rings: ┄Heavy Atoms: 33QED Weighted: 0.33Np Likeness Score: 1.76
References 1. Wang H, Nguyen TT, Li S, Liang T, Zhang Y, Li J.. (2015) Quantitative structure-activity relationship of antifungal activity of rosin derivatives., 25 (2): [PMID:25466709 ] [10.1016/j.bmcl.2014.11.034 ]