N,N-diethyl-2-hydroxy-3-((1R,4aR,4bS,10aR)-7-isopropyl-1,4a-dimethyltetradecahydrophenanthrene-1-carbonyloxy)-N-(oxiran-2-ylmethyl)propan-1-aminium

ID: ALA3358320

PubChem CID: 118722791

Max Phase: Preclinical

Molecular Formula: C30H54NO4+

Molecular Weight: 492.77

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC[N+](CC)(CC(O)COC(=O)[C@]1(C)CCC[C@@]2(C)[C@H]1CCC1CC(C(C)C)CC[C@@H]12)CC1CO1

Standard InChI:  InChI=1S/C30H54NO4/c1-7-31(8-2,18-25-20-34-25)17-24(32)19-35-28(33)30(6)15-9-14-29(5)26-12-10-22(21(3)4)16-23(26)11-13-27(29)30/h21-27,32H,7-20H2,1-6H3/q+1/t22?,23?,24?,25?,26-,27+,29+,30+/m0/s1

Standard InChI Key:  VOGJOTZFTRGYEH-BMPHFDAWSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
    0.7718  -17.2271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7718  -18.0442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4771  -18.4487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4771  -16.8143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1824  -17.2271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1789  -18.0442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8809  -18.4536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5910  -18.0502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8879  -16.8192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5945  -17.2379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3064  -16.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3179  -16.0169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6113  -15.5982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8932  -16.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0308  -15.6173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7332  -16.0348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0411  -14.8002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8851  -19.1546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5931  -17.4582    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1750  -16.4099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8808  -17.6356    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4774  -19.8628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7023  -19.1535    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1118  -19.8607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9290  -19.8597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3385  -20.5669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3367  -19.1514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9308  -21.2751    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.8915  -19.0265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3403  -21.9823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1136  -21.2761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5164  -21.9775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7041  -20.5689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1575  -21.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6992  -21.9698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9912  -21.5528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9835  -22.3699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5  9  1  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 12 15  1  0
 15 16  1  0
 15 17  1  0
  3 18  1  6
  6 19  1  6
  5 20  1  1
  9 21  1  6
 18 22  2  0
 18 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  0
 26 28  1  0
  3 29  1  0
 28 30  1  0
 28 31  1  0
 28 32  1  0
 31 33  1  0
 30 34  1  0
 32 35  1  0
 36 35  1  0
 37 36  1  0
 35 37  1  0
M  CHG  1  28   1
M  END

Alternative Forms

  1. Parent:

    ALA3358320

    ---

Associated Targets(non-human)

Trametes versicolor (86 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Gloeophyllum trabeum (56 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 492.77Molecular Weight (Monoisotopic): 492.4047AlogP: 5.44#Rotatable Bonds: 10
Polar Surface Area: 59.06Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.68CX Basic pKa: CX LogP: 1.69CX LogD: 1.69
Aromatic Rings: Heavy Atoms: 35QED Weighted: 0.25Np Likeness Score: 1.75

References

1. Wang H, Nguyen TT, Li S, Liang T, Zhang Y, Li J..  (2015)  Quantitative structure-activity relationship of antifungal activity of rosin derivatives.,  25  (2): [PMID:25466709] [10.1016/j.bmcl.2014.11.034]

Source