(1alpha,3beta)-17-[3-(4-Hydroxy-4-methylpentyl)phenyl]-9,10-secoandrosta-5,7,10(19),16-tetraen-1,3-diol

ID: ALA3359605

PubChem CID: 118723730

Max Phase: Preclinical

Molecular Formula: C31H42O3

Molecular Weight: 462.67

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C1/C(=C\C=C2/CCC[C@]3(C)C(c4cccc(CCCC(C)(C)O)c4)=CC[C@@H]23)C[C@@H](O)C[C@@H]1O

Standard InChI:  InChI=1S/C31H42O3/c1-21-24(19-26(32)20-29(21)33)13-12-23-11-7-17-31(4)27(23)14-15-28(31)25-10-5-8-22(18-25)9-6-16-30(2,3)34/h5,8,10,12-13,15,18,26-27,29,32-34H,1,6-7,9,11,14,16-17,19-20H2,2-4H3/b23-12+,24-13-/t26-,27+,29+,31+/m1/s1

Standard InChI Key:  OSFWKFCDNSZCKE-QUHRQYLPSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   20.4876   -2.0801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7818   -2.4928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4921   -2.8977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8852   -7.2433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8852   -8.0605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5905   -8.4649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2958   -8.0605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2958   -7.2433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5905   -6.8306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1781   -8.4701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0029   -8.4701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0047   -6.8368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5905   -6.0134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2982   -5.6048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2982   -4.7876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3046   -3.1556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5951   -3.5629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5914   -4.3827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0105   -3.5680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0068   -4.3795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7775   -4.6337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2575   -3.9793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7834   -3.3207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0025   -2.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0375   -2.5474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8390   -2.3822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0950   -1.6069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5507   -0.9963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7470   -1.1661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4947   -1.9411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0025   -5.1962    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.8952   -1.4410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4390   -2.0510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2392   -1.8850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5266   -3.2709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  4  9  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  5 10  1  6
  7 11  1  1
  8 12  2  0
  9 13  2  0
 13 14  1  0
 14 15  2  0
 15 20  1  0
 15 18  1  0
 19 16  1  0
 16 17  1  0
 17 18  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 19  1  0
 19 24  1  1
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 23 25  1  0
 20 31  1  6
 27 32  1  0
 32 33  1  0
 33 34  1  0
 34  2  1  0
  2 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3359605

    ---

Associated Targets(Human)

HL-60 (67320 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

VDR Vitamin D receptor (148 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Biocomponents

Calculated Properties

Molecular Weight: 462.67Molecular Weight (Monoisotopic): 462.3134AlogP: 6.30#Rotatable Bonds: 6
Polar Surface Area: 60.69Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.00CX LogD: 5.00
Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.46Np Likeness Score: 2.10

References

1. Liu C, Zhao GD, Mao X, Suenaga T, Fujishima T, Zhang CM, Liu ZP..  (2014)  Synthesis and biological evaluation of 1α,25-dihydroxyvitamin D3 analogues with aromatic side chains attached at C-17.,  85  [PMID:25127149] [10.1016/j.ejmech.2014.08.031]

Source