2-chloro-N-(2-(2-(5-(3-methylbenzylthio)-1,3,4-thiadiazol-2-ylamino)-2-oxoethylthio)benzo[d]thiazol-6-yl)benzamide

ID: ALA3360915

PubChem CID: 3850491

Max Phase: Preclinical

Molecular Formula: C26H20ClN5O2S4

Molecular Weight: 598.20

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cccc(CSc2nnc(NC(=O)CSc3nc4ccc(NC(=O)c5ccccc5Cl)cc4s3)s2)c1

Standard InChI:  InChI=1S/C26H20ClN5O2S4/c1-15-5-4-6-16(11-15)13-35-26-32-31-24(38-26)30-22(33)14-36-25-29-20-10-9-17(12-21(20)37-25)28-23(34)18-7-2-3-8-19(18)27/h2-12H,13-14H2,1H3,(H,28,34)(H,30,31,33)

Standard InChI Key:  GLERSYALOFZOKS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
    6.8415  -10.6895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8404  -11.5090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5484  -11.9180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5466  -10.2806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2553  -10.6859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2555  -11.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0385  -11.7632    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5222  -11.0971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0381  -10.4313    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.3394  -11.0968    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.7482  -11.8044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5654  -11.8041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9743  -12.5117    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9738  -11.0962    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7910  -11.0960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2691  -11.7577    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0462  -11.5049    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0460  -10.6876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2687  -10.4355    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.7069  -10.2070    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.4536  -10.5391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1145  -10.0584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8599  -10.3949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5204   -9.9150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4350   -9.1014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6834   -8.7701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0260   -9.2520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2670  -10.2475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1337  -10.2811    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1335   -9.4639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8411   -9.0551    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4257   -9.0554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4308   -8.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7238   -7.8291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0153   -8.2380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0181   -9.0594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7256   -9.4640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7292  -10.2812    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 15  1  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 24 28  1  0
  1 29  1  0
 29 30  1  0
 30 31  2  0
 30 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 37 38  1  0
M  END

Associated Targets(Human)

PTPN22 Tchem Hematopoietic cell protein-tyrosine phosphatase 70Z-PEP (1215 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 598.20Molecular Weight (Monoisotopic): 597.0188AlogP: 7.39#Rotatable Bonds: 9
Polar Surface Area: 96.87Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 6.84CX Basic pKa: 1.07CX LogP: 7.63CX LogD: 7.03
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.14Np Likeness Score: -2.80

References

1. Hou X, Li R, Li K, Yu X, Sun JP, Fang H..  (2014)  Fast identification of novel lymphoid tyrosine phosphatase inhibitors using target-ligand interaction-based virtual screening.,  57  (22): [PMID:25372368] [10.1021/jm500692u]

Source