The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-methyl-N-(2-(2-(5-(3-methylbenzylthio)-1,3,4-thiadiazol-2-ylamino)-2-oxoethylthio)benzo[d]thiazol-6-yl)benzamide ID: ALA3360916
PubChem CID: 4270640
Max Phase: Preclinical
Molecular Formula: C27H23N5O2S4
Molecular Weight: 577.78
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cccc(CSc2nnc(NC(=O)CSc3nc4ccc(NC(=O)c5ccccc5C)cc4s3)s2)c1
Standard InChI: InChI=1S/C27H23N5O2S4/c1-16-6-5-8-18(12-16)14-35-27-32-31-25(38-27)30-23(33)15-36-26-29-21-11-10-19(13-22(21)37-26)28-24(34)20-9-4-3-7-17(20)2/h3-13H,14-15H2,1-2H3,(H,28,34)(H,30,31,33)
Standard InChI Key: CKFNWDOKOSWXGZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
3.6264 -12.7036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6253 -13.5231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3333 -13.9321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3315 -12.2947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0401 -12.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0404 -13.5231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8234 -13.7773 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3071 -13.1112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8230 -12.4454 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.1243 -13.1109 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.5331 -13.8185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3503 -13.8182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7591 -14.5257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7587 -13.1103 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5759 -13.1100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0540 -13.7718 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8311 -13.5190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8308 -12.7017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0535 -12.4496 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.4918 -12.2211 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.2384 -12.5532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8994 -12.0725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6448 -12.4090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3053 -11.9291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2199 -11.1155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4683 -10.7841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8109 -11.2661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0518 -12.2615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9186 -12.2951 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9184 -11.4780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6260 -11.0692 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2106 -11.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2157 -10.2516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5087 -9.8432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8001 -10.2520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8030 -11.0735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5105 -11.4781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5141 -12.2953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 15 1 0
18 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
24 28 1 0
1 29 1 0
29 30 1 0
30 31 2 0
30 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
37 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 577.78Molecular Weight (Monoisotopic): 577.0735AlogP: 7.04#Rotatable Bonds: 9Polar Surface Area: 96.87Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.84CX Basic pKa: 1.07CX LogP: 7.54CX LogD: 6.94Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.14Np Likeness Score: -2.69
References 1. Hou X, Li R, Li K, Yu X, Sun JP, Fang H.. (2014) Fast identification of novel lymphoid tyrosine phosphatase inhibitors using target-ligand interaction-based virtual screening., 57 (22): [PMID:25372368 ] [10.1021/jm500692u ]