2-methyl-N-(2-(2-(5-(3-methylbenzylthio)-1,3,4-thiadiazol-2-ylamino)-2-oxoethylthio)benzo[d]thiazol-6-yl)benzamide

ID: ALA3360916

PubChem CID: 4270640

Max Phase: Preclinical

Molecular Formula: C27H23N5O2S4

Molecular Weight: 577.78

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cccc(CSc2nnc(NC(=O)CSc3nc4ccc(NC(=O)c5ccccc5C)cc4s3)s2)c1

Standard InChI:  InChI=1S/C27H23N5O2S4/c1-16-6-5-8-18(12-16)14-35-27-32-31-25(38-27)30-23(33)15-36-26-29-21-11-10-19(13-22(21)37-26)28-24(34)20-9-4-3-7-17(20)2/h3-13H,14-15H2,1-2H3,(H,28,34)(H,30,31,33)

Standard InChI Key:  CKFNWDOKOSWXGZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
    3.6264  -12.7036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6253  -13.5231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3333  -13.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3315  -12.2947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0401  -12.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0404  -13.5231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8234  -13.7773    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3071  -13.1112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8230  -12.4454    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.1243  -13.1109    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.5331  -13.8185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3503  -13.8182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7591  -14.5257    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7587  -13.1103    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5759  -13.1100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0540  -13.7718    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8311  -13.5190    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8308  -12.7017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0535  -12.4496    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.4918  -12.2211    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.2384  -12.5532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8994  -12.0725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6448  -12.4090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3053  -11.9291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2199  -11.1155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4683  -10.7841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8109  -11.2661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0518  -12.2615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9186  -12.2951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9184  -11.4780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6260  -11.0692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2106  -11.0695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2157  -10.2516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5087   -9.8432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8001  -10.2520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8030  -11.0735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5105  -11.4781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5141  -12.2953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 15  1  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 24 28  1  0
  1 29  1  0
 29 30  1  0
 30 31  2  0
 30 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 37 38  1  0
M  END

Associated Targets(Human)

PTPN22 Tchem Hematopoietic cell protein-tyrosine phosphatase 70Z-PEP (1215 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 577.78Molecular Weight (Monoisotopic): 577.0735AlogP: 7.04#Rotatable Bonds: 9
Polar Surface Area: 96.87Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 6.84CX Basic pKa: 1.07CX LogP: 7.54CX LogD: 6.94
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.14Np Likeness Score: -2.69

References

1. Hou X, Li R, Li K, Yu X, Sun JP, Fang H..  (2014)  Fast identification of novel lymphoid tyrosine phosphatase inhibitors using target-ligand interaction-based virtual screening.,  57  (22): [PMID:25372368] [10.1021/jm500692u]

Source