The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(dibenzo[b,d]furan-3-yl)-2-(6-(1,3-dioxoisoindolin-2-yl)benzo[d]thiazol-2-ylthio)acetamide ID: ALA3360917
Cas Number: 312287-02-8
PubChem CID: 3741046
Max Phase: Preclinical
Molecular Formula: C29H17N3O4S2
Molecular Weight: 535.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CSc1nc2ccc(N3C(=O)c4ccccc4C3=O)cc2s1)Nc1ccc2c(c1)oc1ccccc12
Standard InChI: InChI=1S/C29H17N3O4S2/c33-26(30-16-9-11-19-18-5-3-4-8-23(18)36-24(19)13-16)15-37-29-31-22-12-10-17(14-25(22)38-29)32-27(34)20-6-1-2-7-21(20)28(32)35/h1-14H,15H2,(H,30,33)
Standard InChI Key: BADUPGAAEOGWIN-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 44 0 0 0 0 0 0 0 0999 V2000
3.4696 -4.5482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4684 -5.3677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1765 -5.7767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1747 -4.1393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8833 -4.5446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8836 -5.3677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6665 -5.6219 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1503 -4.9558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6661 -4.2900 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.9674 -4.9555 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.3763 -5.6631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1935 -5.6628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6023 -6.3703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7618 -4.1397 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6018 -4.9549 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6801 -3.3228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0193 -4.4680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4723 -3.8610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8775 -3.1532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4672 -2.4506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6519 -2.4545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2487 -3.1669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6613 -3.8666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2885 -2.7772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8486 -5.2672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4190 -4.9546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8244 -5.6631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6409 -5.6632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8217 -4.2483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6368 -4.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0473 -4.9545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1849 -3.6353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9341 -3.9680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8469 -4.7814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5068 -5.2617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2543 -4.9298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3378 -4.1128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6770 -3.6362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
1 14 1 0
12 15 1 0
14 16 1 0
16 19 1 0
18 17 1 0
17 14 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
16 24 2 0
17 25 2 0
15 26 1 0
26 27 2 0
27 28 1 0
28 31 2 0
30 29 2 0
29 26 1 0
30 31 1 0
31 34 1 0
33 32 1 0
32 30 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 535.61Molecular Weight (Monoisotopic): 535.0660AlogP: 6.73#Rotatable Bonds: 5Polar Surface Area: 92.51Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.14CX Basic pKa: 0.88CX LogP: 5.81CX LogD: 5.81Aromatic Rings: 6Heavy Atoms: 38QED Weighted: 0.19Np Likeness Score: -1.76
References 1. Hou X, Li R, Li K, Yu X, Sun JP, Fang H.. (2014) Fast identification of novel lymphoid tyrosine phosphatase inhibitors using target-ligand interaction-based virtual screening., 57 (22): [PMID:25372368 ] [10.1021/jm500692u ]