N-(dibenzo[b,d]furan-3-yl)-2-(6-(1,3-dioxoisoindolin-2-yl)benzo[d]thiazol-2-ylthio)acetamide

ID: ALA3360917

Cas Number: 312287-02-8

PubChem CID: 3741046

Max Phase: Preclinical

Molecular Formula: C29H17N3O4S2

Molecular Weight: 535.61

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CSc1nc2ccc(N3C(=O)c4ccccc4C3=O)cc2s1)Nc1ccc2c(c1)oc1ccccc12

Standard InChI:  InChI=1S/C29H17N3O4S2/c33-26(30-16-9-11-19-18-5-3-4-8-23(18)36-24(19)13-16)15-37-29-31-22-12-10-17(14-25(22)38-29)32-27(34)20-6-1-2-7-21(20)28(32)35/h1-14H,15H2,(H,30,33)

Standard InChI Key:  BADUPGAAEOGWIN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 44  0  0  0  0  0  0  0  0999 V2000
    3.4696   -4.5482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4684   -5.3677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1765   -5.7767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1747   -4.1393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8833   -4.5446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8836   -5.3677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6665   -5.6219    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1503   -4.9558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6661   -4.2900    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.9674   -4.9555    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.3763   -5.6631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1935   -5.6628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6023   -6.3703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7618   -4.1397    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6018   -4.9549    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6801   -3.3228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0193   -4.4680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4723   -3.8610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8775   -3.1532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4672   -2.4506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6519   -2.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2487   -3.1669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6613   -3.8666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2885   -2.7772    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8486   -5.2672    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4190   -4.9546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8244   -5.6631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6409   -5.6632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8217   -4.2483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6368   -4.2449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0473   -4.9545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1849   -3.6353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9341   -3.9680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8469   -4.7814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5068   -5.2617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2543   -4.9298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3378   -4.1128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6770   -3.6362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
  1 14  1  0
 12 15  1  0
 14 16  1  0
 16 19  1  0
 18 17  1  0
 17 14  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 16 24  2  0
 17 25  2  0
 15 26  1  0
 26 27  2  0
 27 28  1  0
 28 31  2  0
 30 29  2  0
 29 26  1  0
 30 31  1  0
 31 34  1  0
 33 32  1  0
 32 30  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 33  1  0
M  END

Associated Targets(Human)

PTPN22 Tchem Hematopoietic cell protein-tyrosine phosphatase 70Z-PEP (1215 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 535.61Molecular Weight (Monoisotopic): 535.0660AlogP: 6.73#Rotatable Bonds: 5
Polar Surface Area: 92.51Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.14CX Basic pKa: 0.88CX LogP: 5.81CX LogD: 5.81
Aromatic Rings: 6Heavy Atoms: 38QED Weighted: 0.19Np Likeness Score: -1.76

References

1. Hou X, Li R, Li K, Yu X, Sun JP, Fang H..  (2014)  Fast identification of novel lymphoid tyrosine phosphatase inhibitors using target-ligand interaction-based virtual screening.,  57  (22): [PMID:25372368] [10.1021/jm500692u]

Source