The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 2-(2-(6-(1,3-dioxoisoindolin-2-yl)benzo[d]thiazol-2-ylthio)acetamido)benzoate ID: ALA3360918
Cas Number: 330957-08-9
PubChem CID: 1595768
Max Phase: Preclinical
Molecular Formula: C25H17N3O5S2
Molecular Weight: 503.56
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccccc1NC(=O)CSc1nc2ccc(N3C(=O)c4ccccc4C3=O)cc2s1
Standard InChI: InChI=1S/C25H17N3O5S2/c1-33-24(32)17-8-4-5-9-18(17)26-21(29)13-34-25-27-19-11-10-14(12-20(19)35-25)28-22(30)15-6-2-3-7-16(15)23(28)31/h2-12H,13H2,1H3,(H,26,29)
Standard InChI Key: VUMSCHMXOAEQDX-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
3.4696 -4.5482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4684 -5.3677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1765 -5.7767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1747 -4.1393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8833 -4.5446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8836 -5.3677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6665 -5.6219 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1503 -4.9558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6661 -4.2900 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.9674 -4.9555 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.3763 -5.6631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1935 -5.6628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6023 -6.3703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7618 -4.1397 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6018 -4.9549 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6801 -3.3228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0193 -4.4680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4723 -3.8610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8775 -3.1532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4672 -2.4506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6519 -2.4545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2487 -3.1669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6613 -3.8666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2885 -2.7772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8486 -5.2672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4190 -4.9546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8244 -5.6631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6409 -5.6632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0500 -4.9548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6368 -4.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8217 -4.2483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4097 -3.5426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8149 -2.8329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5926 -3.5465 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6321 -2.8290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
1 14 1 0
12 15 1 0
14 16 1 0
16 19 1 0
18 17 1 0
17 14 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
16 24 2 0
17 25 2 0
15 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
31 32 1 0
32 33 1 0
32 34 2 0
33 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 503.56Molecular Weight (Monoisotopic): 503.0610AlogP: 4.61#Rotatable Bonds: 6Polar Surface Area: 105.67Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.48CX Basic pKa: 0.88CX LogP: 5.28CX LogD: 5.28Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.23Np Likeness Score: -1.89
References 1. Hou X, Li R, Li K, Yu X, Sun JP, Fang H.. (2014) Fast identification of novel lymphoid tyrosine phosphatase inhibitors using target-ligand interaction-based virtual screening., 57 (22): [PMID:25372368 ] [10.1021/jm500692u ]