methyl 2-(2-(6-(1,3-dioxoisoindolin-2-yl)benzo[d]thiazol-2-ylthio)acetamido)benzoate

ID: ALA3360918

Cas Number: 330957-08-9

PubChem CID: 1595768

Max Phase: Preclinical

Molecular Formula: C25H17N3O5S2

Molecular Weight: 503.56

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)c1ccccc1NC(=O)CSc1nc2ccc(N3C(=O)c4ccccc4C3=O)cc2s1

Standard InChI:  InChI=1S/C25H17N3O5S2/c1-33-24(32)17-8-4-5-9-18(17)26-21(29)13-34-25-27-19-11-10-14(12-20(19)35-25)28-22(30)15-6-2-3-7-16(15)23(28)31/h2-12H,13H2,1H3,(H,26,29)

Standard InChI Key:  VUMSCHMXOAEQDX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    3.4696   -4.5482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4684   -5.3677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1765   -5.7767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1747   -4.1393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8833   -4.5446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8836   -5.3677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6665   -5.6219    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1503   -4.9558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6661   -4.2900    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.9674   -4.9555    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.3763   -5.6631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1935   -5.6628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6023   -6.3703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7618   -4.1397    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6018   -4.9549    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6801   -3.3228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0193   -4.4680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4723   -3.8610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8775   -3.1532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4672   -2.4506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6519   -2.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2487   -3.1669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6613   -3.8666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2885   -2.7772    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8486   -5.2672    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4190   -4.9546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8244   -5.6631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6409   -5.6632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0500   -4.9548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6368   -4.2449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8217   -4.2483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4097   -3.5426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8149   -2.8329    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5926   -3.5465    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6321   -2.8290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
  1 14  1  0
 12 15  1  0
 14 16  1  0
 16 19  1  0
 18 17  1  0
 17 14  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 16 24  2  0
 17 25  2  0
 15 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 31 32  1  0
 32 33  1  0
 32 34  2  0
 33 35  1  0
M  END

Associated Targets(Human)

PTPN22 Tchem Hematopoietic cell protein-tyrosine phosphatase 70Z-PEP (1215 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 503.56Molecular Weight (Monoisotopic): 503.0610AlogP: 4.61#Rotatable Bonds: 6
Polar Surface Area: 105.67Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.48CX Basic pKa: 0.88CX LogP: 5.28CX LogD: 5.28
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.23Np Likeness Score: -1.89

References

1. Hou X, Li R, Li K, Yu X, Sun JP, Fang H..  (2014)  Fast identification of novel lymphoid tyrosine phosphatase inhibitors using target-ligand interaction-based virtual screening.,  57  (22): [PMID:25372368] [10.1021/jm500692u]

Source