4-Dimethylamino-3,5,10,12,12a-pentahydroxy-6-(4-methoxy-phenylsulfanylmethyl)-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydro-naphthacene-2-carboxylic acid amide

ID: ALA339135

Max Phase: Preclinical

Molecular Formula: C29H30N2O9S

Molecular Weight: 582.63

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(SC[C@H]2c3cccc(O)c3C(=O)C3=C(O)[C@]4(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C4[C@@H](O)C32)cc1

Standard InChI:  InChI=1S/C29H30N2O9S/c1-31(2)22-21-24(34)18-15(11-41-13-9-7-12(40-3)8-10-13)14-5-4-6-16(32)17(14)23(33)19(18)26(36)29(21,39)27(37)20(25(22)35)28(30)38/h4-10,15,18,21-22,24,32,34,36-37,39H,11H2,1-3H3,(H2,30,38)/t15-,18?,21?,22-,24-,29-/m0/s1

Standard InChI Key:  GPNZCSGRGOIAPN-RPGGHDGHSA-N

Molfile:  

     RDKit          2D

 41 45  0  0  1  0  0  0  0  0999 V2000
    6.3542   -5.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9292   -5.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3625   -4.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7792   -5.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6417   -5.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0625   -5.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7875   -4.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2167   -5.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9292   -4.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0750   -3.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5000   -5.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6500   -3.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2167   -3.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5042   -4.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4917   -5.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2167   -2.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0792   -2.9542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0542   -6.2542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2125   -6.2542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7875   -5.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3500   -5.8375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5042   -2.5292    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.4792   -6.2750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6292   -6.2417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5042   -3.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6500   -2.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2042   -5.0417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7750   -2.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7875   -3.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3250   -2.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7917   -6.2542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2792   -2.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5500   -3.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8250   -3.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5542   -2.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6000   -3.1500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0667   -4.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0667   -5.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8000   -2.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3667   -2.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1000   -2.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  5  2  0
  3  1  1  0
  4  6  2  0
  5  1  1  0
  6  1  1  0
  7  4  1  0
  8  2  1  0
  9  2  1  0
 10  3  1  0
 11  8  1  0
 12  3  1  0
 13  9  1  0
 14 13  1  0
 15  4  1  0
 13 16  1  6
 10 17  1  6
 18  6  1  0
 19  8  2  0
 20 11  2  0
  1 21  1  6
 22 16  1  0
 23 15  2  0
 24  5  1  0
 25  7  2  0
 12 26  1  6
 27 15  1  0
 28 22  1  0
 29 14  2  0
 30 34  1  0
 31 20  1  0
 32 28  2  0
 33 28  1  0
 34 33  2  0
 35 32  1  0
 36 30  1  0
 37 29  1  0
 38 20  1  0
 39 17  1  0
 40 17  1  0
 41 36  1  0
  9 12  1  0
 10  7  1  0
 11 14  1  0
 38 37  2  0
 30 35  2  0
M  END

Alternative Forms

  1. Parent:

    ALA339135

    ---

Associated Targets(non-human)

mdfA Multidrug translocase mdfA (30 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 582.63Molecular Weight (Monoisotopic): 582.1672AlogP: 1.43#Rotatable Bonds: 6
Polar Surface Area: 190.85Molecular Species: ACIDHBA: 11HBD: 6
#RO5 Violations: 3HBA (Lipinski): 11HBD (Lipinski): 7#RO5 Violations (Lipinski): 3
CX Acidic pKa: 2.74CX Basic pKa: 5.77CX LogP: -1.90CX LogD: -2.88
Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.21Np Likeness Score: 0.89

References

1. Nelson ML, Park BH, Andrews JS, Georgian VA, Thomas RC, Levy SB..  (1993)  Inhibition of the tetracycline efflux antiport protein by 13-thio-substituted 5-hydroxy-6-deoxytetracyclines.,  36  (3): [PMID:8426364] [10.1021/jm00055a008]

Source