The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID85302056 ID: ALA3391715
PubChem CID: 118725001
Max Phase: Preclinical
Molecular Formula: C21H32O3
Molecular Weight: 332.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#C[C@]1(O)[C@H](O)C[C@H]2[C@@H]3CC[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C
Standard InChI: InChI=1S/C21H32O3/c1-4-21(24)18(23)12-17-15-6-5-13-11-14(22)7-9-19(13,2)16(15)8-10-20(17,21)3/h1,13-18,22-24H,5-12H2,2-3H3/t13-,14-,15+,16-,17-,18+,19-,20-,21-/m0/s1
Standard InChI Key: JZPIBNJWXHUXHF-KWHXHVTNSA-N
Molfile:
RDKit 2D
28 31 0 0 1 0 0 0 0 0999 V2000
3.1198 0.7590 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3130 -0.4590 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3895 -0.2307 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4832 0.6406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3077 0.6138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2029 -0.1353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3907 -0.2806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1411 0.3502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9532 0.2049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5370 -0.1787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8542 -0.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9513 1.2713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1392 1.1261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2335 -0.5710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1104 -1.0565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2482 1.4366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8430 1.3830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7017 -1.2017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4850 0.8356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0456 -0.7162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6729 0.9809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5774 -0.0855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2971 0.6904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1887 2.2595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5733 -1.5115 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.3546 -0.4467 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.0052 -0.9363 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.6042 0.5163 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 1
10 2 1 6
22 3 1 1
4 5 1 0
4 6 1 0
4 12 1 0
4 17 1 1
5 10 1 0
5 16 1 0
6 7 1 0
6 11 1 0
7 8 1 0
7 15 1 0
8 9 1 0
8 13 1 0
9 14 1 0
9 19 1 0
9 21 1 1
10 11 1 0
12 13 1 0
14 18 1 0
14 20 1 0
15 18 1 0
16 24 3 0
19 23 1 0
20 22 1 0
22 23 1 0
14 25 1 6
8 26 1 6
6 27 1 6
7 28 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 332.48Molecular Weight (Monoisotopic): 332.2351AlogP: 2.73#Rotatable Bonds: ┄Polar Surface Area: 60.69Molecular Species: NEUTRALHBA: 3HBD: 3#RO5 Violations: ┄HBA (Lipinski): 3HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.01CX Basic pKa: ┄CX LogP: 2.28CX LogD: 2.28Aromatic Rings: ┄Heavy Atoms: 24QED Weighted: 0.60Np Likeness Score: 2.37
References 1. PubChem BioAssay data set,