The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
{1-[1-(1-{1-Hydroxy-2-[1-(3-methyl-butylcarbamoyl)-ethylcarbamoyl]-ethyl}-3-methyl-butylcarbamoyl)-2-methyl-propylcarbamoyl]-2-methyl-propyl}-carbamic acid tert-butyl ester ID: ALA3392083
PubChem CID: 118725159
Max Phase: Preclinical
Molecular Formula: C31H59N5O7
Molecular Weight: 613.84
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)CCNC(=O)[C@H](C)NC(=O)C[C@@H](O)[C@@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)C)C(C)C
Standard InChI: InChI=1S/C31H59N5O7/c1-17(2)13-14-32-27(39)21(9)33-24(38)16-23(37)22(15-18(3)4)34-28(40)25(19(5)6)35-29(41)26(20(7)8)36-30(42)43-31(10,11)12/h17-23,25-26,37H,13-16H2,1-12H3,(H,32,39)(H,33,38)(H,34,40)(H,35,41)(H,36,42)/t21-,22+,23+,25-,26-/m0/s1
Standard InChI Key: GQYQVRLKCQSBAG-GDKKAJJHSA-N
Molfile:
RDKit 2D
43 42 0 0 1 0 0 0 0 0999 V2000
8.5051 -7.1213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4232 -6.4657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8427 -6.6296 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6817 -6.9574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6661 -6.7935 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0856 -6.9574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8271 -6.4657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2622 -6.7935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5842 -6.1379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9246 -7.2852 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7451 -5.8100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0037 -6.3018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1647 -5.9739 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2466 -6.6296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4076 -6.3018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3442 -7.4491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4105 -7.9409 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5178 -5.6461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7763 -6.1379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7325 -7.2852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8398 -4.9905 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0983 -5.4822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1012 -7.1213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0119 -6.1379 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9910 -7.7770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3568 -5.9739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1520 -7.4491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6744 -5.6461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4359 -4.9905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3129 -7.1213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8583 -6.7935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7734 -6.3643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4290 -7.8784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6944 -5.4822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1139 -5.6461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6534 -8.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2339 -8.1048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4314 -5.9739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0939 -5.4822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6788 -5.3183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5305 -4.1709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8509 -5.8100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9992 -4.6627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 6 1 0
3 1 1 0
4 10 1 0
5 2 1 0
6 3 1 0
7 9 1 0
8 1 1 0
9 14 1 0
10 8 1 0
11 15 1 0
12 5 1 0
13 7 1 0
14 12 1 0
15 13 1 0
16 4 1 0
17 1 2 0
18 2 2 0
19 4 2 0
20 7 2 0
21 11 2 0
12 22 1 1
23 16 1 0
24 11 1 0
6 25 1 1
8 26 1 6
14 27 1 6
28 24 1 0
29 22 1 0
15 30 1 1
31 23 1 0
32 23 1 0
33 23 1 0
34 26 1 0
35 26 1 0
36 25 1 0
37 25 1 0
38 28 1 0
39 38 1 0
40 29 1 0
41 29 1 0
42 39 1 0
43 39 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 613.84Molecular Weight (Monoisotopic): 613.4414AlogP: 2.63#Rotatable Bonds: 17Polar Surface Area: 174.96Molecular Species: NEUTRALHBA: 7HBD: 6#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.39CX Basic pKa: ┄CX LogP: 2.82CX LogD: 2.82Aromatic Rings: ┄Heavy Atoms: 43QED Weighted: 0.15Np Likeness Score: 0.00
References 1. Agarwal NS, Rich DH.. (1986) Inhibition of cathepsin D by substrate analogues containing statine and by analogues of pepstatin., 29 (12): [PMID:3783611 ] [10.1021/jm00162a015 ]