The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Hydroxy-6-methyl-4-{3-methyl-2-[3-methyl-2-(3-methyl-butyrylamino)-butyrylamino]-butyrylamino}-heptanoic acid [1-(3-methyl-butylcarbamoyl)-ethyl]-amide ID: ALA3392084
PubChem CID: 118725160
Max Phase: Preclinical
Molecular Formula: C31H59N5O6
Molecular Weight: 597.84
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)CCNC(=O)[C@H](C)NC(=O)C[C@H](O)[C@@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CC(C)C)C(C)C)C(C)C
Standard InChI: InChI=1S/C31H59N5O6/c1-17(2)12-13-32-29(40)22(11)33-26(39)16-24(37)23(14-18(3)4)34-30(41)28(21(9)10)36-31(42)27(20(7)8)35-25(38)15-19(5)6/h17-24,27-28,37H,12-16H2,1-11H3,(H,32,40)(H,33,39)(H,34,41)(H,35,38)(H,36,42)/t22-,23+,24-,27-,28-/m0/s1
Standard InChI Key: JTZSUTRATHTTMW-DWFKVPPKSA-N
Molfile:
RDKit 2D
42 41 0 0 1 0 0 0 0 0999 V2000
12.1990 -5.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0556 -4.7227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4846 -4.7227 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3411 -5.1352 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7701 -5.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4833 -5.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9135 -4.7227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1977 -4.7227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6280 -5.1352 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3424 -4.7227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6267 -4.7227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3398 -4.7227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7688 -4.7227 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9122 -5.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0543 -5.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1990 -5.9602 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0556 -3.8977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4833 -5.9602 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3398 -3.8977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3424 -3.8977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6267 -3.8977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6254 -5.1352 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0569 -5.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7701 -5.9602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9135 -3.8977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9122 -5.9602 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9109 -4.7227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9122 -3.4852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7714 -4.7227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0543 -5.9602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6280 -3.4852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1990 -3.4852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4846 -6.3727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0556 -6.3727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1964 -5.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4820 -4.7227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1977 -3.8977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9122 -2.6602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4859 -5.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7714 -3.8977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7675 -5.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4820 -3.8977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 1 1 0
4 2 1 0
5 3 1 0
6 8 1 0
7 1 1 0
8 14 1 0
9 7 1 0
10 9 1 0
11 4 1 0
12 15 1 0
13 6 1 0
14 11 1 0
15 13 1 0
16 1 2 0
17 2 2 0
18 6 2 0
19 12 2 0
20 10 2 0
11 21 1 1
22 12 1 0
23 10 1 0
5 24 1 1
7 25 1 6
14 26 1 1
27 22 1 0
28 21 1 0
29 23 1 0
15 30 1 1
31 25 1 0
32 25 1 0
33 24 1 0
34 24 1 0
35 27 1 0
36 35 1 0
37 28 1 0
38 28 1 0
39 29 1 0
40 29 1 0
41 36 1 0
42 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 597.84Molecular Weight (Monoisotopic): 597.4465AlogP: 2.26#Rotatable Bonds: 19Polar Surface Area: 165.73Molecular Species: NEUTRALHBA: 6HBD: 6#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.32CX Basic pKa: ┄CX LogP: 2.57CX LogD: 2.57Aromatic Rings: ┄Heavy Atoms: 42QED Weighted: 0.13Np Likeness Score: 0.14
References 1. Agarwal NS, Rich DH.. (1986) Inhibition of cathepsin D by substrate analogues containing statine and by analogues of pepstatin., 29 (12): [PMID:3783611 ] [10.1021/jm00162a015 ]