The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1-{1-Benzyl-2-hydroxy-3-[1-(3-methyl-butylcarbamoyl)-ethylcarbamoyl]-propylcarbamoyl}-2-methyl-propyl)-carbamic acid tert-butyl ester ID: ALA3392087
PubChem CID: 118725163
Max Phase: Preclinical
Molecular Formula: C29H48N4O6
Molecular Weight: 548.73
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)CCNC(=O)[C@H](C)NC(=O)C[C@H](O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)C
Standard InChI: InChI=1S/C29H48N4O6/c1-18(2)14-15-30-26(36)20(5)31-24(35)17-23(34)22(16-21-12-10-9-11-13-21)32-27(37)25(19(3)4)33-28(38)39-29(6,7)8/h9-13,18-20,22-23,25,34H,14-17H2,1-8H3,(H,30,36)(H,31,35)(H,32,37)(H,33,38)/t20-,22-,23-,25-/m0/s1
Standard InChI Key: KAVIURCQYOJSCT-IVIIFCHOSA-N
Molfile:
RDKit 2D
40 40 0 0 1 0 0 0 0 0999 V2000
-1.5327 -1.9168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6464 -2.0426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1864 -2.4200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.0193 -2.7975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7700 -2.2313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3655 -2.2942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1162 -1.7281 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.9491 -2.1055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1984 -2.6717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7819 -2.4830 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6028 -2.6088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4357 -2.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3002 -1.5394 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6416 -1.0990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7554 -2.8604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.0581 -1.2877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9103 -3.6153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.3073 -1.8539 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0629 -1.8539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8521 -3.1749 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6610 -3.0491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8207 -0.9732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4939 -3.4265 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.6148 -2.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3267 -3.8040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8256 -2.1684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3774 -1.0912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7483 -2.6166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1017 -3.3636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3148 -3.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.2685 -3.3636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.0312 -3.0491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9297 -0.1554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4745 -1.4765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.6850 -3.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1402 -2.2313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2372 -1.1619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6924 0.1591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3461 -0.3442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8401 -2.9233 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 7 1 0
3 1 1 0
4 6 1 0
5 1 1 0
11 6 1 0
7 5 1 0
8 3 1 6
12 9 1 0
10 4 1 0
8 11 1 0
12 10 1 0
13 2 1 0
14 1 2 0
15 2 2 0
8 16 1 0
17 4 2 0
18 9 2 0
19 13 1 0
20 9 1 0
5 21 1 1
22 16 1 0
11 23 1 1
24 20 1 0
12 25 1 1
26 19 1 0
27 19 1 0
28 19 1 0
29 21 1 0
30 21 1 0
31 24 1 0
32 31 1 0
33 22 2 0
34 22 1 0
35 32 1 0
36 32 1 0
37 34 2 0
38 33 1 0
39 37 1 0
11 40 1 6
38 39 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 548.73Molecular Weight (Monoisotopic): 548.3574AlogP: 2.68#Rotatable Bonds: 14Polar Surface Area: 145.86Molecular Species: NEUTRALHBA: 6HBD: 5#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.74CX Basic pKa: ┄CX LogP: 2.87CX LogD: 2.87Aromatic Rings: 1Heavy Atoms: 39QED Weighted: 0.24Np Likeness Score: -0.13
References 1. Agarwal NS, Rich DH.. (1986) Inhibition of cathepsin D by substrate analogues containing statine and by analogues of pepstatin., 29 (12): [PMID:3783611 ] [10.1021/jm00162a015 ]