The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3,6-Dimethyl-4-{3-methyl-2-[3-methyl-2-(3-methyl-butyrylamino)-butyrylamino]-butyrylamino}-heptanoic acid [1-(3-methyl-butylcarbamoyl)-ethyl]-amide ID: ALA3392090
PubChem CID: 118725166
Max Phase: Preclinical
Molecular Formula: C32H61N5O5
Molecular Weight: 595.87
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)CCNC(=O)[C@H](C)NC(=O)C[C@H](C)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CC(C)C)C(C)C)C(C)C
Standard InChI: InChI=1S/C32H61N5O5/c1-18(2)13-14-33-30(40)24(12)34-27(39)17-23(11)25(15-19(3)4)35-31(41)29(22(9)10)37-32(42)28(21(7)8)36-26(38)16-20(5)6/h18-25,28-29H,13-17H2,1-12H3,(H,33,40)(H,34,39)(H,35,41)(H,36,38)(H,37,42)/t23-,24-,25-,28-,29-/m0/s1
Standard InChI Key: VBROOHAYFVCWQQ-ROFHDDJXSA-N
Molfile:
RDKit 2D
42 41 0 0 1 0 0 0 0 0999 V2000
7.3960 -6.6309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2526 -6.2184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6816 -6.2184 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5381 -6.6309 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9671 -6.6309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1105 -6.2184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6803 -6.6309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8250 -6.6309 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5394 -6.2184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4632 -6.2184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9658 -6.2184 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8237 -6.2184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2513 -6.6309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3947 -6.2184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3960 -7.4559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2526 -5.3934 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1092 -6.6309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6803 -7.4559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4632 -5.3934 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5394 -5.3934 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8237 -5.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1776 -6.6309 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2539 -6.6309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9671 -7.4559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1105 -5.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8921 -6.2184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1092 -4.9809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9684 -6.2184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2513 -7.4559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1092 -7.4559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8250 -4.9809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3960 -4.9809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6816 -7.8684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2526 -7.8684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6066 -6.6309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3210 -6.2184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3947 -5.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1092 -4.1559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6828 -6.6309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9684 -5.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0355 -6.6309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3210 -5.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 1 1 0
4 2 1 0
5 3 1 0
6 1 1 0
7 14 1 0
8 6 1 0
9 8 1 0
10 13 1 0
11 7 1 0
12 4 1 0
13 11 1 0
14 17 1 0
15 1 2 0
16 2 2 0
17 12 1 0
18 7 2 0
19 10 2 0
20 9 2 0
12 21 1 6
22 10 1 0
23 9 1 0
5 24 1 1
6 25 1 6
26 22 1 0
27 21 1 0
28 23 1 0
13 29 1 1
17 30 1 1
31 25 1 0
32 25 1 0
33 24 1 0
34 24 1 0
35 26 1 0
36 35 1 0
37 27 1 0
38 27 1 0
39 28 1 0
40 28 1 0
41 36 1 0
42 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 595.87Molecular Weight (Monoisotopic): 595.4673AlogP: 3.54#Rotatable Bonds: 19Polar Surface Area: 145.50Molecular Species: NEUTRALHBA: 5HBD: 5#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.45CX Basic pKa: ┄CX LogP: 3.86CX LogD: 3.86Aromatic Rings: ┄Heavy Atoms: 42QED Weighted: 0.16Np Likeness Score: -0.13
References 1. Agarwal NS, Rich DH.. (1986) Inhibition of cathepsin D by substrate analogues containing statine and by analogues of pepstatin., 29 (12): [PMID:3783611 ] [10.1021/jm00162a015 ]