The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1-{1-Benzyl-2-methyl-3-[1-(3-methyl-butylcarbamoyl)-ethylcarbamoyl]-propylcarbamoyl}-2-methyl-propyl)-carbamic acid tert-butyl ester ID: ALA3392093
PubChem CID: 118725169
Max Phase: Preclinical
Molecular Formula: C35H59N5O6
Molecular Weight: 645.89
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)CCNC(=O)[C@H](C)NC(=O)C[C@H](C)[C@@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)C)C(C)C
Standard InChI: InChI=1S/C35H59N5O6/c1-21(2)17-18-36-31(42)25(8)37-28(41)19-24(7)27(20-26-15-13-12-14-16-26)38-32(43)29(22(3)4)39-33(44)30(23(5)6)40-34(45)46-35(9,10)11/h12-16,21-25,27,29-30H,17-20H2,1-11H3,(H,36,42)(H,37,41)(H,38,43)(H,39,44)(H,40,45)/t24-,25-,27+,29-,30-/m0/s1
Standard InChI Key: YDGPAIMBSACIBH-SMQJSEMVSA-N
Molfile:
RDKit 2D
46 46 0 0 1 0 0 0 0 0999 V2000
0.6627 -3.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7873 -3.8379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3793 -3.8629 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5663 -3.4504 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0541 -3.3630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0246 -3.9003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4282 -3.4004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7120 -3.5004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4244 -3.9128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5111 -3.8462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2870 -3.8462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1531 -3.8087 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8404 -3.3505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7159 -3.8254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5752 -2.7006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7373 -4.7085 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0035 -3.4254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3037 -4.6710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4157 -2.5756 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4153 -4.6627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4452 -4.7377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2651 -3.5129 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1492 -3.4379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0166 -2.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0204 -4.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0285 -5.0709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0108 -3.8753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9366 -3.8254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9362 -2.5214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9910 -2.6006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7498 -2.0257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2501 -2.1007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7078 -5.0834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6919 -5.1001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0733 -4.7002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8148 -5.0501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0410 -5.8957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7284 -4.6377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6697 -3.3380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9948 -4.7002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8773 -5.8749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4980 -4.5877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4490 -5.0376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7617 -6.2874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4657 -5.8624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6510 -4.2379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 1 1 0
4 2 1 0
5 3 1 0
6 1 1 0
7 14 1 0
8 6 1 0
9 8 1 0
10 13 1 0
11 4 1 0
12 7 1 0
13 12 1 0
14 17 1 0
15 1 2 0
16 2 2 0
17 11 1 0
11 18 1 1
19 7 2 0
20 10 2 0
21 9 2 0
22 10 1 0
23 9 1 0
5 24 1 1
6 25 1 6
26 18 1 0
27 22 1 0
28 23 1 0
13 29 1 1
17 30 1 1
31 24 1 0
32 24 1 0
33 25 1 0
34 25 1 0
35 27 1 0
36 35 1 0
37 26 2 0
38 26 1 0
39 28 1 0
40 28 1 0
41 36 1 0
42 36 1 0
43 38 2 0
44 37 1 0
45 43 1 0
44 45 2 0
28 46 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 645.89Molecular Weight (Monoisotopic): 645.4465AlogP: 4.10#Rotatable Bonds: 17Polar Surface Area: 154.73Molecular Species: NEUTRALHBA: 6HBD: 5#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.46CX Basic pKa: ┄CX LogP: 4.50CX LogD: 4.50Aromatic Rings: 1Heavy Atoms: 46QED Weighted: 0.17Np Likeness Score: -0.32
References 1. Agarwal NS, Rich DH.. (1986) Inhibition of cathepsin D by substrate analogues containing statine and by analogues of pepstatin., 29 (12): [PMID:3783611 ] [10.1021/jm00162a015 ]