4-[2-(2,2-Dimethyl-propionylamino)-3-methyl-butyrylamino]-3-hydroxy-6-methyl-heptanoic acid [1-(3-methyl-butylcarbamoyl)-ethyl]-amide

ID: ALA3392100

PubChem CID: 118725175

Max Phase: Preclinical

Molecular Formula: C26H50N4O5

Molecular Weight: 498.71

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CC(C)CCNC(=O)[C@H](C)NC(=O)C[C@H](O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)C(C)(C)C)C(C)C

Standard InChI:  InChI=1S/C26H50N4O5/c1-15(2)11-12-27-23(33)18(7)28-21(32)14-20(31)19(13-16(3)4)29-24(34)22(17(5)6)30-25(35)26(8,9)10/h15-20,22,31H,11-14H2,1-10H3,(H,27,33)(H,28,32)(H,29,34)(H,30,35)/t18-,19-,20-,22-/m0/s1

Standard InChI Key:  YPOJNUPLWCADQV-XWUOBKMESA-N

Molfile:  

     RDKit          2D

 36 35  0  0  1  0  0  0  0  0999 V2000
    8.0691   -3.7796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4856   -3.5909    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2482   -3.9054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4154   -4.2829    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8318   -4.0941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5825   -4.6603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2363   -4.1570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6527   -3.9683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4034   -4.5345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8199   -4.3458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9020   -3.4022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9990   -4.4716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1661   -4.8490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9602   -2.9618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3572   -4.7232    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6915   -5.4781    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2945   -3.7167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5438   -3.1505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7497   -5.0377    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9408   -4.9119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1079   -5.2893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9870   -4.7232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7811   -2.8360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5557   -2.8989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3987   -2.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4052   -4.0559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2751   -5.6668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7035   -5.2264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2870   -5.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3333   -5.2264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4294   -4.9119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1273   -3.3393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6721   -2.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0832   -5.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5384   -4.0941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7617   -4.7861    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  5  1  0
  3  2  1  0
  4  1  1  0
  5  1  1  0
  6  7  1  0
 12  7  1  0
  8  4  1  6
 13  9  1  0
 10  6  1  0
 11  3  1  0
  8 12  1  0
 13 10  1  0
 14  1  2  0
 15  3  2  0
 16  6  2  0
 17  9  2  0
  8 18  1  0
 19  9  1  0
  5 20  1  1
 12 21  1  1
 22 19  1  0
 23 18  1  0
 24 11  1  0
 25 11  1  0
 26 11  1  0
 13 27  1  1
 28 20  1  0
 29 20  1  0
 30 22  1  0
 31 30  1  0
 32 23  1  0
 33 23  1  0
 34 31  1  0
 35 31  1  0
 12 36  1  6
M  END

Alternative Forms

1. Parent:

   

   ALA3392100

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 498.71

Molecular Weight (Monoisotopic): 498.3781

AlogP: 2.12

#Rotatable Bonds: 14

Polar Surface Area: 136.63

Molecular Species: NEUTRAL

HBA: 5

HBD: 5

#RO5 Violations: ┄

HBA (Lipinski): 9

HBD (Lipinski): 5

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 12.57

CX Basic pKa: ┄

CX LogP: 2.59

CX LogD: 2.59

Aromatic Rings: ┄

Heavy Atoms: 35

QED Weighted: 0.25

Np Likeness Score: 0.05

References

1. Agarwal NS, Rich DH..  (1986)  Inhibition of cathepsin D by substrate analogues containing statine and by analogues of pepstatin.,  29  (12): [PMID:3783611] [10.1021/jm00162a015]

Source

Source(1):

• Scientific Literature