The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[2-(2,2-Dimethyl-propionylamino)-3-methyl-butyrylamino]-3-hydroxy-6-methyl-heptanoic acid [1-(3-methyl-butylcarbamoyl)-ethyl]-amide ID: ALA3392100
PubChem CID: 118725175
Max Phase: Preclinical
Molecular Formula: C26H50N4O5
Molecular Weight: 498.71
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)CCNC(=O)[C@H](C)NC(=O)C[C@H](O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)C(C)(C)C)C(C)C
Standard InChI: InChI=1S/C26H50N4O5/c1-15(2)11-12-27-23(33)18(7)28-21(32)14-20(31)19(13-16(3)4)29-24(34)22(17(5)6)30-25(35)26(8,9)10/h15-20,22,31H,11-14H2,1-10H3,(H,27,33)(H,28,32)(H,29,34)(H,30,35)/t18-,19-,20-,22-/m0/s1
Standard InChI Key: YPOJNUPLWCADQV-XWUOBKMESA-N
Molfile:
RDKit 2D
36 35 0 0 1 0 0 0 0 0999 V2000
8.0691 -3.7796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4856 -3.5909 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2482 -3.9054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4154 -4.2829 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8318 -4.0941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5825 -4.6603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2363 -4.1570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6527 -3.9683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4034 -4.5345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8199 -4.3458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9020 -3.4022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9990 -4.4716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1661 -4.8490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9602 -2.9618 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3572 -4.7232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6915 -5.4781 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2945 -3.7167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5438 -3.1505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7497 -5.0377 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9408 -4.9119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1079 -5.2893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9870 -4.7232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7811 -2.8360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5557 -2.8989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3987 -2.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4052 -4.0559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2751 -5.6668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7035 -5.2264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2870 -5.4152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3333 -5.2264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4294 -4.9119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1273 -3.3393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6721 -2.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0832 -5.4152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5384 -4.0941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7617 -4.7861 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 2 1 0
4 1 1 0
5 1 1 0
6 7 1 0
12 7 1 0
8 4 1 6
13 9 1 0
10 6 1 0
11 3 1 0
8 12 1 0
13 10 1 0
14 1 2 0
15 3 2 0
16 6 2 0
17 9 2 0
8 18 1 0
19 9 1 0
5 20 1 1
12 21 1 1
22 19 1 0
23 18 1 0
24 11 1 0
25 11 1 0
26 11 1 0
13 27 1 1
28 20 1 0
29 20 1 0
30 22 1 0
31 30 1 0
32 23 1 0
33 23 1 0
34 31 1 0
35 31 1 0
12 36 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 498.71Molecular Weight (Monoisotopic): 498.3781AlogP: 2.12#Rotatable Bonds: 14Polar Surface Area: 136.63Molecular Species: NEUTRALHBA: 5HBD: 5#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.57CX Basic pKa: ┄CX LogP: 2.59CX LogD: 2.59Aromatic Rings: ┄Heavy Atoms: 35QED Weighted: 0.25Np Likeness Score: 0.05
References 1. Agarwal NS, Rich DH.. (1986) Inhibition of cathepsin D by substrate analogues containing statine and by analogues of pepstatin., 29 (12): [PMID:3783611 ] [10.1021/jm00162a015 ]