The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-{3-Hydroxy-6-methyl-4-[3-methyl-2-(3-methyl-butyrylamino)-butyrylamino]-heptanoylamino}-propionylamino)-3-phenyl-propionic acid methyl ester ID: ALA3392101
PubChem CID: 118725176
Max Phase: Preclinical
Molecular Formula: C31H50N4O7
Molecular Weight: 590.76
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](C)NC(=O)C[C@H](O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)CC(C)C)C(C)C
Standard InChI: InChI=1S/C31H50N4O7/c1-18(2)14-23(33-30(40)28(20(5)6)35-26(37)15-19(3)4)25(36)17-27(38)32-21(7)29(39)34-24(31(41)42-8)16-22-12-10-9-11-13-22/h9-13,18-21,23-25,28,36H,14-17H2,1-8H3,(H,32,38)(H,33,40)(H,34,39)(H,35,37)/t21-,23-,24-,25-,28-/m0/s1
Standard InChI Key: JNINEXBQGLJCOP-FTVGXNHISA-N
Molfile:
RDKit 2D
43 43 0 0 1 0 0 0 0 0999 V2000
6.1813 -1.3932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5032 -2.0488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5188 -1.8849 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1592 -2.5405 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6798 -2.2127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9384 -1.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3423 -1.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9163 -2.2127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6008 -1.2293 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3579 -1.5571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0109 -1.3932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9228 -1.8849 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7618 -1.5571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2603 -2.3766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0993 -2.0488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0866 -0.5736 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4086 -1.2293 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5787 -2.7045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7745 -3.0323 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3485 -0.9014 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4525 -2.3766 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6671 -0.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0203 -1.0653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0330 -2.5405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7680 -1.0653 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3358 -2.3766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1940 -2.8684 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9101 -0.4097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3550 -3.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7774 -1.3932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7901 -2.8684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3706 -3.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8626 -0.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4304 -1.5571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9982 -2.8684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2476 -0.9014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8154 0.4099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4398 -0.9014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8720 -2.2127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7553 -2.5405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1875 -1.2293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8499 -1.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8564 -2.3766 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14 2 1 0
3 1 1 0
4 2 1 0
5 7 1 0
6 1 1 0
15 7 1 0
8 4 1 0
9 6 1 0
10 9 1 0
11 8 1 0
12 5 1 0
13 3 1 6
14 12 1 0
13 15 1 0
16 1 2 0
17 2 2 0
8 18 1 1
19 5 2 0
20 11 2 0
21 10 2 0
13 22 1 0
23 10 1 0
6 24 1 1
25 11 1 0
26 18 1 0
15 27 1 1
28 22 1 0
14 29 1 1
30 23 1 0
31 24 1 0
32 24 1 0
33 25 1 0
34 26 2 0
35 26 1 0
36 28 1 0
37 28 1 0
38 30 1 0
39 30 1 0
40 35 2 0
41 34 1 0
42 40 1 0
15 43 1 6
41 42 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 590.76Molecular Weight (Monoisotopic): 590.3679AlogP: 1.86#Rotatable Bonds: 17Polar Surface Area: 162.93Molecular Species: NEUTRALHBA: 7HBD: 5#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.90CX Basic pKa: ┄CX LogP: 2.46CX LogD: 2.46Aromatic Rings: 1Heavy Atoms: 42QED Weighted: 0.17Np Likeness Score: 0.21
References 1. Agarwal NS, Rich DH.. (1986) Inhibition of cathepsin D by substrate analogues containing statine and by analogues of pepstatin., 29 (12): [PMID:3783611 ] [10.1021/jm00162a015 ]