The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{3-Hydroxy-6-methyl-4-[3-methyl-2-(3-methyl-butyrylamino)-butyrylamino]-heptanoylamino}-propionic acid methyl ester ID: ALA3392103
PubChem CID: 118725178
Max Phase: Preclinical
Molecular Formula: C22H41N3O6
Molecular Weight: 443.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@H](C)NC(=O)C[C@H](O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)CC(C)C)C(C)C
Standard InChI: InChI=1S/C22H41N3O6/c1-12(2)9-16(17(26)11-19(28)23-15(7)22(30)31-8)24-21(29)20(14(5)6)25-18(27)10-13(3)4/h12-17,20,26H,9-11H2,1-8H3,(H,23,28)(H,24,29)(H,25,27)/t15-,16-,17-,20-/m0/s1
Standard InChI Key: IXBBSGVZUPOAKN-BOSXTWCSSA-N
Molfile:
RDKit 2D
32 31 0 0 1 0 0 0 0 0999 V2000
2.5570 -1.8173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8426 -2.2298 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0153 -2.2298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2715 -2.2298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3008 -1.8173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9860 -1.8173 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7005 -2.2298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1281 -1.8173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7298 -1.8173 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1587 -1.8173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4136 -2.2298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4443 -2.2298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5570 -0.9923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0153 -3.0548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7005 -3.0548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1587 -0.9923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1281 -0.9923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4149 -1.8173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2715 -3.0548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8732 -2.2298 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4136 -3.0548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4136 -0.5798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1294 -2.2298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4443 -3.0548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9860 -3.4673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5570 -3.4673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5877 -1.8173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3008 -0.9923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4136 0.2452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8439 -1.8173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1294 -3.0548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1281 -2.6423 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 5 1 0
4 1 1 0
11 5 1 0
6 4 1 0
7 6 1 0
8 2 1 6
9 3 1 0
12 10 1 0
8 11 1 0
12 9 1 0
13 1 2 0
14 3 2 0
15 7 2 0
16 10 2 0
8 17 1 0
18 7 1 0
4 19 1 1
20 10 1 0
11 21 1 1
22 17 1 0
23 18 1 0
12 24 1 1
25 19 1 0
26 19 1 0
27 20 1 0
28 22 1 0
29 22 1 0
30 23 1 0
31 23 1 0
11 32 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 443.59Molecular Weight (Monoisotopic): 443.2995AlogP: 1.13#Rotatable Bonds: 13Polar Surface Area: 133.83Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.35CX Basic pKa: ┄CX LogP: 1.34CX LogD: 1.34Aromatic Rings: ┄Heavy Atoms: 31QED Weighted: 0.32Np Likeness Score: 0.30
References 1. Agarwal NS, Rich DH.. (1986) Inhibition of cathepsin D by substrate analogues containing statine and by analogues of pepstatin., 29 (12): [PMID:3783611 ] [10.1021/jm00162a015 ]