The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Dimethyl-(5-methyl-1-[1-(3-methyl-butylcarbamoyl)-ethylcarbamoyl]-3-{3-methyl-2-[3-methyl-2-(3-methyl-butyrylamino)-butyrylamino]-butyrylamino}-2-oxo-hexyl)-sulfonium ID: ALA3392190
PubChem CID: 118725213
Max Phase: Preclinical
Molecular Formula: C33H62ClN5O6S
Molecular Weight: 656.96
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)CCNC(=O)[C@H](C)NC(=O)C(C(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CC(C)C)C(C)C)C(C)C)[S+](C)C.[Cl-]
Standard InChI: InChI=1S/C33H61N5O6S.ClH/c1-18(2)14-15-34-30(41)23(11)35-33(44)29(45(12)13)28(40)24(16-19(3)4)36-31(42)27(22(9)10)38-32(43)26(21(7)8)37-25(39)17-20(5)6;/h18-24,26-27,29H,14-17H2,1-13H3,(H4-,34,35,36,37,38,39,41,42,43,44);1H/t23-,24-,26-,27-,29?;/m0./s1
Standard InChI Key: ZRTUZHWNSMALCG-NCZPPGLASA-N
Molfile:
RDKit 2D
46 44 0 0 0 0 0 0 0 0999 V2000
9.6992 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.8282 -0.0386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5427 -0.4511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1138 -0.4511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1731 -0.4511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0297 -0.0386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4586 -0.0386 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3993 -0.0386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3152 -0.4511 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2572 -0.0386 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7441 -0.4511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8282 0.7864 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.8875 -0.0386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6020 -0.4511 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3165 -0.0386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6861 -0.0386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9716 -0.4511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5427 -1.2761 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1138 -1.2761 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1731 -1.2761 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0297 0.7864 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3993 0.7864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6861 0.7864 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3165 0.7864 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.4006 -0.4511 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0310 -0.4511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7441 -1.2761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8875 0.7864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1151 -0.0386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1138 1.1989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5427 1.1989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3152 1.1989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9716 -1.2761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7454 -0.0386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0297 -1.6886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4586 -1.6886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6020 1.1989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1731 1.1989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.8295 -0.4511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5440 -0.0386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3152 2.0239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1357 1.2852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4599 -0.4511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7454 0.7864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.2585 -0.4511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5440 0.7864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 0
4 2 1 0
5 7 1 0
6 9 1 0
7 11 1 0
8 4 1 0
9 8 1 0
10 3 1 0
11 6 1 0
2 12 1 0
13 5 1 0
14 13 1 0
15 14 1 0
16 17 1 0
17 10 1 0
18 3 2 0
19 4 2 0
20 5 2 0
21 6 2 0
8 22 1 6
23 16 2 0
24 15 2 0
25 16 1 0
26 15 1 0
11 27 1 1
13 28 1 6
29 25 1 0
30 12 1 0
31 12 1 0
32 22 1 0
17 33 1 1
34 26 1 0
35 27 1 0
36 27 1 0
37 28 1 0
38 28 1 0
39 29 1 0
40 39 1 0
41 32 1 0
42 32 1 0
43 34 1 0
44 34 1 0
45 40 1 0
46 40 1 0
M CHG 2 1 -1 12 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 656.96Molecular Weight (Monoisotopic): 656.4415AlogP: 2.33#Rotatable Bonds: 20Polar Surface Area: 162.57Molecular Species: NEUTRALHBA: 6HBD: 5#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.88CX Basic pKa: ┄CX LogP: 2.76CX LogD: 2.76Aromatic Rings: ┄Heavy Atoms: 45QED Weighted: 0.10Np Likeness Score: -0.11
References 1. Agarwal NS, Rich DH.. (1986) Inhibition of cathepsin D by substrate analogues containing statine and by analogues of pepstatin., 29 (12): [PMID:3783611 ] [10.1021/jm00162a015 ]