4-(2-Anthracen-9-yl-phenyl)-2,6-dimethyl-1,4-dihydro-pyridine-3,5-dicarboxylic acid diethyl ester

ID: ALA3392228

PubChem CID: 44318679

Max Phase: Preclinical

Molecular Formula: C33H31NO4

Molecular Weight: 505.61

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1c1ccccc1-c1c2ccccc2cc2ccccc12

Standard InChI:  InChI=1S/C33H31NO4/c1-5-37-32(35)28-20(3)34-21(4)29(33(36)38-6-2)31(28)27-18-12-11-17-26(27)30-24-15-9-7-13-22(24)19-23-14-8-10-16-25(23)30/h7-19,31,34H,5-6H2,1-4H3

Standard InChI Key:  MZUWUOHYPWPBOP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  1  0  0  0  0  0999 V2000
    8.8846   -1.6448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1221   -0.9303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2971   -0.9303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2971   -2.3592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5346   -1.6448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1221   -2.3592    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1320    1.0598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6840   -0.3783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1320    0.2348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0596   -1.6448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5346   -0.2158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8465    1.4723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4175    1.4723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8465    2.2973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4175    2.2973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1320    2.7098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2391   -1.5585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3596   -0.2158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6471   -2.3592    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1221    0.4986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3596   -1.6448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8846   -3.0737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3250    0.0633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4291   -1.1629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5609    1.0598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7030    1.0598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7030    2.7098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5609    2.7098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8221   -2.3592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5346    1.2131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6221   -1.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0701   -0.7213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9886    1.4723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2754    1.4723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4096   -3.0737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3596    1.2131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2754    2.2973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9886    2.2973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  1  1  0
  4  1  2  0
  5  6  1  0
  6  4  1  0
  7  9  1  0
  3  8  1  0
  9  8  2  0
 10  1  1  0
 11  2  1  0
 12  7  1  0
 13  7  2  0
 14 12  1  0
 15 13  1  0
 16 15  2  0
 17 10  2  0
 18 11  2  0
 19 10  1  0
 20 11  1  0
 21  5  1  0
 22  4  1  0
 23  9  1  0
 24  8  1  0
 25 12  2  0
 26 13  1  0
 27 15  1  0
 28 14  2  0
 29 19  1  0
 30 20  1  0
 31 24  2  0
 32 31  1  0
 33 26  2  0
 34 25  1  0
 35 29  1  0
 36 30  1  0
 37 34  2  0
 38 33  1  0
  2  5  2  0
 23 32  2  0
 14 16  1  0
 27 38  2  0
 28 37  1  0
M  END

Associated Targets(Human)

CACNA1C Tclin Voltage-gated L-type calcium channel alpha-1C subunit (766 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 505.61Molecular Weight (Monoisotopic): 505.2253AlogP: 7.02#Rotatable Bonds: 6
Polar Surface Area: 64.63Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 6.22CX LogD: 6.22
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.23Np Likeness Score: -0.17

References

1. Straub A, Goehrt A, Born L.  (1997)  4-Biaryl-substituted dihydropyridines with an unusual antiperiplanar conformation,  (19): [10.1016/S0960-894X(97)10006-3]

Source