The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-Anthracen-9-yl-phenyl)-2,6-dimethyl-1,4-dihydro-pyridine-3,5-dicarboxylic acid diethyl ester ID: ALA3392228
PubChem CID: 44318679
Max Phase: Preclinical
Molecular Formula: C33H31NO4
Molecular Weight: 505.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1c1ccccc1-c1c2ccccc2cc2ccccc12
Standard InChI: InChI=1S/C33H31NO4/c1-5-37-32(35)28-20(3)34-21(4)29(33(36)38-6-2)31(28)27-18-12-11-17-26(27)30-24-15-9-7-13-22(24)19-23-14-8-10-16-25(23)30/h7-19,31,34H,5-6H2,1-4H3
Standard InChI Key: MZUWUOHYPWPBOP-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 1 0 0 0 0 0999 V2000
8.8846 -1.6448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1221 -0.9303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2971 -0.9303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2971 -2.3592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5346 -1.6448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1221 -2.3592 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1320 1.0598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6840 -0.3783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1320 0.2348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0596 -1.6448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5346 -0.2158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8465 1.4723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4175 1.4723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8465 2.2973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4175 2.2973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1320 2.7098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2391 -1.5585 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3596 -0.2158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6471 -2.3592 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1221 0.4986 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3596 -1.6448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8846 -3.0737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3250 0.0633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4291 -1.1629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5609 1.0598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7030 1.0598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7030 2.7098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5609 2.7098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8221 -2.3592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5346 1.2131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6221 -1.3344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0701 -0.7213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9886 1.4723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2754 1.4723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4096 -3.0737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3596 1.2131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2754 2.2973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9886 2.2973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 1 1 0
4 1 2 0
5 6 1 0
6 4 1 0
7 9 1 0
3 8 1 0
9 8 2 0
10 1 1 0
11 2 1 0
12 7 1 0
13 7 2 0
14 12 1 0
15 13 1 0
16 15 2 0
17 10 2 0
18 11 2 0
19 10 1 0
20 11 1 0
21 5 1 0
22 4 1 0
23 9 1 0
24 8 1 0
25 12 2 0
26 13 1 0
27 15 1 0
28 14 2 0
29 19 1 0
30 20 1 0
31 24 2 0
32 31 1 0
33 26 2 0
34 25 1 0
35 29 1 0
36 30 1 0
37 34 2 0
38 33 1 0
2 5 2 0
23 32 2 0
14 16 1 0
27 38 2 0
28 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 505.61Molecular Weight (Monoisotopic): 505.2253AlogP: 7.02#Rotatable Bonds: 6Polar Surface Area: 64.63Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.22CX LogD: 6.22Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.23Np Likeness Score: -0.17
References 1. Straub A, Goehrt A, Born L. (1997) 4-Biaryl-substituted dihydropyridines with an unusual antiperiplanar conformation, 7 (19): [10.1016/S0960-894X(97)10006-3 ]