The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1'S,4'S)-5'-Cyano-2',6'-dimethyl-4-naphthalen-2-yl-1',4'-dihydro-[3,4']bipyridinyl-3'-carboxylic acid ethyl ester ID: ALA3392230
PubChem CID: 44318909
Max Phase: Preclinical
Molecular Formula: C26H23N3O2
Molecular Weight: 409.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)C1=C(C)NC(C)=C(C#N)[C@@H]1c1cnccc1-c1ccc2ccccc2c1
Standard InChI: InChI=1S/C26H23N3O2/c1-4-31-26(30)24-17(3)29-16(2)22(14-27)25(24)23-15-28-12-11-21(23)20-10-9-18-7-5-6-8-19(18)13-20/h5-13,15,25,29H,4H2,1-3H3/t25-/m1/s1
Standard InChI Key: DRAFQLUUZHHPFJ-RUZDIDTESA-N
Molfile:
RDKit 2D
31 34 0 0 1 0 0 0 0 0999 V2000
3.5455 -1.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2599 -0.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9744 -1.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5455 -1.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2599 -2.3292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9744 -1.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2599 0.1458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8310 -0.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9744 0.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5983 -1.0173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6913 -0.8870 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8310 0.1458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5455 1.3833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6889 0.1458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5455 0.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1165 -1.0917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8310 -2.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6889 -2.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9744 1.3833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2599 1.7958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6889 -0.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4034 0.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4021 -0.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6876 -1.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1178 0.1458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4034 -1.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1178 -0.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8323 -1.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5468 -0.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5468 0.1458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8323 0.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 1 2 0
5 4 1 0
6 5 1 0
2 7 1 1
8 1 1 0
9 7 2 0
10 3 1 0
11 10 3 0
12 8 2 0
13 15 2 0
14 9 1 0
15 7 1 0
16 8 1 0
17 4 1 0
18 6 1 0
19 9 1 0
20 13 1 0
21 14 2 0
22 14 1 0
23 16 1 0
24 23 1 0
25 22 2 0
26 21 1 0
6 3 2 0
19 20 2 0
27 26 2 0
27 28 1 0
27 25 1 0
25 31 1 0
28 29 2 0
29 30 1 0
30 31 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 409.49Molecular Weight (Monoisotopic): 409.1790AlogP: 5.22#Rotatable Bonds: 4Polar Surface Area: 75.01Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.86CX LogP: 3.50CX LogD: 3.50Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.60Np Likeness Score: -0.78
References 1. Straub A, Goehrt A, Born L. (1997) 4-Biaryl-substituted dihydropyridines with an unusual antiperiplanar conformation, 7 (19): [10.1016/S0960-894X(97)10006-3 ]