The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-{2-[3-(2-Acetyl-phenoxy)-2-hydroxy-propylamino]-ethyl}-3-phenyl-urea; compound with oxalic acid ID: ALA3392258
PubChem CID: 13030934
Max Phase: Preclinical
Molecular Formula: C22H27N3O8
Molecular Weight: 371.44
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)c1ccccc1OCC(O)CNCCNC(=O)Nc1ccccc1.O=C(O)C(=O)O
Standard InChI: InChI=1S/C20H25N3O4.C2H2O4/c1-15(24)18-9-5-6-10-19(18)27-14-17(25)13-21-11-12-22-20(26)23-16-7-3-2-4-8-16;3-1(4)2(5)6/h2-10,17,21,25H,11-14H2,1H3,(H2,22,23,26);(H,3,4)(H,5,6)
Standard InChI Key: SZXCDXZDRDNXQX-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 33 0 0 0 0 0 0 0 0999 V2000
5.5098 -6.6884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3348 -6.6884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7473 -7.4029 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7473 -5.9739 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0973 -5.9739 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0973 -7.4029 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2417 -3.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1000 -3.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9542 -3.8417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1000 -2.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8125 -3.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5292 -3.4042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2417 -2.5917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3875 -2.1542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5292 -3.8292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2417 -3.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9542 -3.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6750 -3.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3875 -3.4167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9625 -2.5792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3917 -3.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6667 -3.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8167 -2.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8125 -4.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8167 -3.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1000 -3.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6667 -2.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3792 -3.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3917 -4.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1000 -5.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1000 -3.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3792 -2.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1042 -2.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
1 5 2 0
1 6 1 0
8 11 1 0
9 7 1 0
10 8 1 0
11 12 1 0
12 16 1 0
13 7 2 0
14 10 2 0
15 7 1 0
16 17 1 0
17 22 1 0
18 9 1 0
19 26 1 0
20 17 1 0
21 8 2 0
22 19 1 0
23 10 1 0
24 11 2 0
25 15 1 0
26 25 1 0
27 18 1 0
28 18 2 0
29 21 1 0
30 24 1 0
31 28 1 0
32 27 2 0
33 31 2 0
33 32 1 0
29 30 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 371.44Molecular Weight (Monoisotopic): 371.1845AlogP: 2.04#Rotatable Bonds: 10Polar Surface Area: 99.69Molecular Species: BASEHBA: 5HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.46CX Basic pKa: 8.69CX LogP: 1.31CX LogD: 0.00Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.38Np Likeness Score: -1.10
References 1. Lare MS, Smith LH.. (1982) Beta-adrenergic blocking agents. 22. 1-Phenoxy-3-[[(substituted-amido) alkyl]amino]-2-propanols., 25 (11): [PMID:6128420 ] [10.1021/jm00353a004 ]