The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-{2-[2-Hydroxy-3-(2-vinyl-phenoxy)-propylamino]-ethyl}-3-phenyl-urea; compound with oxalic acid hydrate ID: ALA3392259
PubChem CID: 13030930
Max Phase: Preclinical
Molecular Formula: C22H27N3O7
Molecular Weight: 355.44
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=Cc1ccccc1OCC(O)CNCCNC(=O)Nc1ccccc1.O=C(O)C(=O)O
Standard InChI: InChI=1S/C20H25N3O3.C2H2O4/c1-2-16-8-6-7-11-19(16)26-15-18(24)14-21-12-13-22-20(25)23-17-9-4-3-5-10-17;3-1(4)2(5)6/h2-11,18,21,24H,1,12-15H2,(H2,22,23,25);(H,3,4)(H,5,6)
Standard InChI Key: NGEWNVUGQRCZMF-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 32 0 0 0 0 0 0 0 0999 V2000
5.0679 -7.8080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8929 -7.8080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3054 -8.5225 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3054 -7.0936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6554 -7.0936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6554 -8.5225 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2292 -3.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9417 -3.8292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5167 -3.4000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2292 -2.5875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8000 -3.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0875 -3.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0875 -2.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5167 -3.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8042 -2.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2292 -3.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9417 -3.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6625 -3.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3750 -3.4042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9500 -2.5750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6542 -3.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8000 -4.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8042 -3.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3792 -3.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0875 -3.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3667 -3.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6542 -2.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3792 -4.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0875 -5.0375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3667 -2.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0875 -3.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0917 -2.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
1 5 2 0
1 6 1 0
8 7 1 0
9 16 1 0
10 7 2 0
11 9 1 0
12 11 1 0
13 12 1 0
14 7 1 0
15 13 2 0
16 17 1 0
17 21 1 0
18 8 1 0
19 25 1 0
20 17 1 0
21 19 1 0
22 11 2 0
23 14 1 0
24 12 2 0
25 23 1 0
26 18 2 0
27 18 1 0
28 29 2 0
29 22 1 0
30 27 2 0
31 26 1 0
32 30 1 0
32 31 2 0
28 24 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 355.44Molecular Weight (Monoisotopic): 355.1896AlogP: 2.48#Rotatable Bonds: 10Polar Surface Area: 82.62Molecular Species: BASEHBA: 4HBD: 4#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.46CX Basic pKa: 8.79CX LogP: 2.49CX LogD: 1.09Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.49Np Likeness Score: -0.96
References 1. Lare MS, Smith LH.. (1982) Beta-adrenergic blocking agents. 22. 1-Phenoxy-3-[[(substituted-amido) alkyl]amino]-2-propanols., 25 (11): [PMID:6128420 ] [10.1021/jm00353a004 ]