1-[2-(2-Hydroxy-3-phenoxy-propylamino)-ethyl]-3-phenyl-urea hydrate

ID: ALA3392260

PubChem CID: 118725269

Max Phase: Preclinical

Molecular Formula: C18H25N3O4

Molecular Weight: 329.40

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O.O=C(NCCNCC(O)COc1ccccc1)Nc1ccccc1

Standard InChI:  InChI=1S/C18H23N3O3.H2O/c22-16(14-24-17-9-5-2-6-10-17)13-19-11-12-20-18(23)21-15-7-3-1-4-8-15;/h1-10,16,19,22H,11-14H2,(H2,20,21,23);1H2

Standard InChI Key:  ZUKUXBZOAKLEDV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 25 25  0  0  0  0  0  0  0  0999 V2000
    5.0089   -9.7821    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3417   -8.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0542   -8.7000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3417   -7.4542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6292   -8.6917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6292   -8.2667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0542   -8.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7750   -8.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3417   -8.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4875   -8.2750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9125   -8.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0625   -7.4417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7667   -8.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9167   -8.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2000   -8.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4792   -8.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7667   -7.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2000   -8.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9125   -9.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4917   -8.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2000   -8.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4792   -7.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2000   -9.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4917   -9.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2042   -7.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0
  4  2  2  0
  5  2  1  0
  6  9  1  0
  7 13  1  0
  8  3  1  0
  9  7  1  0
 10 15  1  0
 11  6  1  0
 12  7  1  0
 13 10  1  0
 14  5  1  0
 15 14  1  0
 16  8  2  0
 17  8  1  0
 18 11  1  0
 19 11  2  0
 20 18  2  0
 21 16  1  0
 22 17  2  0
 23 19  1  0
 24 23  2  0
 25 22  1  0
 25 21  2  0
 24 20  1  0
M  END

Associated Targets(Human)

ADRB1 Tclin Adrenergic receptor beta (1214 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 329.40Molecular Weight (Monoisotopic): 329.1739AlogP: 1.84#Rotatable Bonds: 9
Polar Surface Area: 82.62Molecular Species: BASEHBA: 4HBD: 4
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 13.46CX Basic pKa: 8.79CX LogP: 1.75CX LogD: 0.35
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.53Np Likeness Score: -1.20

References

1. Lare MS, Smith LH..  (1982)  Beta-adrenergic blocking agents. 22. 1-Phenoxy-3-[[(substituted-amido) alkyl]amino]-2-propanols.,  25  (11): [PMID:6128420] [10.1021/jm00353a004]

Source