N-[2-(2-Hydroxy-3-phenoxy-propylamino)-ethyl]-2-(2-methoxy-phenoxy)-acetamide; compound with oxalic acid hydrate

ID: ALA3392261

PubChem CID: 118725270

Max Phase: Preclinical

Molecular Formula: C22H30N2O10

Molecular Weight: 374.44

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccccc1OCC(=O)NCCNCC(O)COc1ccccc1.O.O=C(O)C(=O)O

Standard InChI:  InChI=1S/C20H26N2O5.C2H2O4.H2O/c1-25-18-9-5-6-10-19(18)27-15-20(24)22-12-11-21-13-16(23)14-26-17-7-3-2-4-8-17;3-1(4)2(5)6;/h2-10,16,21,23H,11-15H2,1H3,(H,22,24);(H,3,4)(H,5,6);1H2

Standard InChI Key:  YQKDIKZVKHMRCU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 33  0  0  0  0  0  0  0  0999 V2000
    8.4562   -6.5411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8955   -3.3361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3235   -3.3444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0375   -3.7578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8955   -2.5094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0375   -4.5845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6095   -3.7578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1816   -3.7495    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1712   -3.3194    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5991   -3.3236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8852   -3.7369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0271   -3.3319    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4447   -3.7327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3110   -4.9978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5991   -2.4927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3131   -3.7452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7514   -3.3444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4676   -3.3319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7514   -4.9978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7411   -3.7452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4447   -4.5594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7307   -3.3110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5970   -4.5762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4654   -3.7578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4654   -4.5887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0293   -3.7327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7307   -4.9645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0293   -4.5594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7143   -7.1304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5393   -7.1304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9518   -7.8448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9518   -6.4159    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3018   -6.4159    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3018   -7.8448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  7  1  0
  4  3  1  0
  5  2  2  0
  6  4  2  0
  7  2  1  0
  8  2  1  0
  9 11  1  0
 10 16  1  0
 11 10  1  0
 12 20  1  0
 13  9  1  0
 14  6  1  0
 15 10  1  0
 16 12  1  0
 17  4  1  0
 18  8  1  0
 19  6  1  0
 20 18  1  0
 21 13  2  0
 22 13  1  0
 23 14  1  0
 24 17  2  0
 25 19  2  0
 26 22  2  0
 27 21  1  0
 28 26  1  0
 25 24  1  0
 27 28  2  0
 29 30  1  0
 30 31  1  0
 30 32  2  0
 29 33  2  0
 29 34  1  0
M  END

Associated Targets(Human)

ADRB1 Tclin Adrenergic receptor beta (1214 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 374.44Molecular Weight (Monoisotopic): 374.1842AlogP: 1.22#Rotatable Bonds: 12
Polar Surface Area: 89.05Molecular Species: BASEHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.79CX LogP: 1.20CX LogD: -0.20
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.48Np Likeness Score: -0.88

References

1. Lare MS, Smith LH..  (1982)  Beta-adrenergic blocking agents. 22. 1-Phenoxy-3-[[(substituted-amido) alkyl]amino]-2-propanols.,  25  (11): [PMID:6128420] [10.1021/jm00353a004]

Source