N-{2-[3-(2-Cyano-phenoxy)-2-hydroxy-propylamino]-ethyl}-2,2-dimethyl-propionamide; compound with oxalic acid hydrate

ID: ALA3392263

PubChem CID: 118725271

Max Phase: Preclinical

Molecular Formula: C19H29N3O8

Molecular Weight: 319.41

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(C)C(=O)NCCNCC(O)COc1ccccc1C#N.O.O=C(O)C(=O)O

Standard InChI:  InChI=1S/C17H25N3O3.C2H2O4.H2O/c1-17(2,3)16(22)20-9-8-19-11-14(21)12-23-15-7-5-4-6-13(15)10-18;3-1(4)2(5)6;/h4-7,14,19,21H,8-9,11-12H2,1-3H3,(H,20,22);(H,3,4)(H,5,6);1H2

Standard InChI Key:  NVAKXUXCOXPDLT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 28  0  0  0  0  0  0  0  0999 V2000
   10.1062   -5.9223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9042   -3.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9042   -5.1792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1917   -4.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4667   -4.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6167   -3.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4667   -3.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1917   -3.1167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9042   -2.3042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1917   -3.5417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9042   -3.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6167   -3.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0417   -3.1292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6167   -2.2917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7542   -4.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6167   -4.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4167   -3.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3292   -3.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3292   -3.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7542   -3.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4792   -3.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7542   -3.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0542   -4.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0542   -3.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8063   -7.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6313   -7.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0438   -7.7270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0438   -6.2980    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3938   -6.2980    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3938   -7.7270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  4  3  0
  4  5  1  0
  5  7  2  0
  6  2  1  0
  7  8  1  0
  8 11  1  0
  9  2  2  0
 10  2  1  0
 11 12  1  0
 12 19  1  0
 13 22  1  0
 14 12  1  0
 15  5  1  0
 16  6  1  0
 17  6  1  0
 18  6  1  0
 19 13  1  0
 20  7  1  0
 21 10  1  0
 22 21  1  0
 23 15  2  0
 24 20  2  0
 23 24  1  0
 25 26  1  0
 26 27  1  0
 26 28  2  0
 25 29  2  0
 25 30  1  0
M  END

Associated Targets(Human)

ADRB1 Tclin Adrenergic receptor beta (1214 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 319.41Molecular Weight (Monoisotopic): 319.1896AlogP: 1.05#Rotatable Bonds: 8
Polar Surface Area: 94.38Molecular Species: BASEHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.79CX LogP: 1.50CX LogD: 0.10
Aromatic Rings: 1Heavy Atoms: 23QED Weighted: 0.62Np Likeness Score: -1.23

References

1. Lare MS, Smith LH..  (1982)  Beta-adrenergic blocking agents. 22. 1-Phenoxy-3-[[(substituted-amido) alkyl]amino]-2-propanols.,  25  (11): [PMID:6128420] [10.1021/jm00353a004]

Source