N-[2-(2-Hydroxy-3-phenoxy-propylamino)-2-methyl-propyl]-2-phenyl-acetamide hydrate

ID: ALA3392264

PubChem CID: 118725272

Max Phase: Preclinical

Molecular Formula: C21H30N2O4

Molecular Weight: 356.47

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(CNC(=O)Cc1ccccc1)NCC(O)COc1ccccc1.O

Standard InChI:  InChI=1S/C21H28N2O3.H2O/c1-21(2,16-22-20(25)13-17-9-5-3-6-10-17)23-14-18(24)15-26-19-11-7-4-8-12-19;/h3-12,18,23-24H,13-16H2,1-2H3,(H,22,25);1H2

Standard InChI Key:  ZUTXCJWTCCZIOT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 27  0  0  0  0  0  0  0  0999 V2000
    5.1796    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3465    2.0466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6320    1.6341    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7969   -0.0159    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0824    0.3966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0610    1.6341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3465    2.8716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2259   -2.4909    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6320    0.8091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5114   -1.2534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7969   -0.8409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5114   -2.0784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2259   -3.3159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0610    3.2841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2259   -0.8409    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4949    1.1111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3301   -0.3178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5114   -3.7284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9403   -3.7284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0610    4.1091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7754    2.8716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5114   -4.5534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7754    4.5216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4899    3.2841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9403   -4.5534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2259   -4.9659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4899    4.1091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0
  4  5  1  0
  5  9  1  0
  6  2  2  0
  7  2  1  0
  8 12  1  0
  9  3  1  0
 10 11  1  0
 11  4  1  0
 12 10  1  0
 13  8  1  0
 14  7  1  0
 15 10  1  0
 16  5  1  0
 17  5  1  0
 18 13  1  0
 19 13  2  0
 20 14  2  0
 21 14  1  0
 22 18  2  0
 23 20  1  0
 24 21  2  0
 25 19  1  0
 26 25  2  0
 27 24  1  0
 27 23  2  0
 26 22  1  0
M  END

Associated Targets(Human)

ADRB1 Tclin Adrenergic receptor beta (1214 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 356.47Molecular Weight (Monoisotopic): 356.2100AlogP: 2.15#Rotatable Bonds: 10
Polar Surface Area: 70.59Molecular Species: BASEHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.97CX LogP: 2.37CX LogD: 0.80
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.61Np Likeness Score: -0.84

References

1. Lare MS, Smith LH..  (1982)  Beta-adrenergic blocking agents. 22. 1-Phenoxy-3-[[(substituted-amido) alkyl]amino]-2-propanols.,  25  (11): [PMID:6128420] [10.1021/jm00353a004]

Source