2-Dimethylamino-N-[2-(2-hydroxy-3-phenoxy-propylamino)-ethyl]-benzamide hydrate

ID: ALA3392268

PubChem CID: 118725274

Max Phase: Preclinical

Molecular Formula: C20H29N3O4

Molecular Weight: 357.45

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)c1ccccc1C(=O)NCCNCC(O)COc1ccccc1.O

Standard InChI:  InChI=1S/C20H27N3O3.H2O/c1-23(2)19-11-7-6-10-18(19)20(25)22-13-12-21-14-16(24)15-26-17-8-4-3-5-9-17;/h3-11,16,21,24H,12-15H2,1-2H3,(H,22,25);1H2

Standard InChI Key:  DYFRGKHSTCZLMX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 27  0  0  0  0  0  0  0  0999 V2000
    0.9429   -7.3366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3490   -5.5243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0625   -5.1112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6356   -5.1112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0625   -4.2851    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6356   -4.2851    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9221   -5.5243    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0848   -5.0945    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3422   -5.0987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3713   -5.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3448   -6.3504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7774   -5.0987    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8025   -5.5075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3505   -4.2726    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7760   -5.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0556   -5.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7843   -3.8720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3490   -3.8720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2086   -5.1070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4909   -5.5201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8025   -6.3337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5159   -5.0862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0583   -6.7635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7760   -6.3629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5159   -6.7384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2252   -5.5075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2252   -6.3337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  4  2  1  0
  5  3  1  0
  6  4  2  0
  7  4  1  0
  8 10  1  0
  9 16  1  0
 10  9  1  0
 11  2  1  0
 12 20  1  0
 13  8  1  0
 14  9  1  0
 15  3  1  0
 16 12  1  0
 17  5  1  0
 18  5  1  0
 19  7  1  0
 20 19  1  0
 21 13  2  0
 22 13  1  0
 23 11  2  0
 24 23  1  0
 25 21  1  0
 26 22  2  0
 27 26  1  0
 24 15  2  0
 25 27  2  0
M  END

Associated Targets(Human)

ADRB1 Tclin Adrenergic receptor beta (1214 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 357.45Molecular Weight (Monoisotopic): 357.2052AlogP: 1.51#Rotatable Bonds: 10
Polar Surface Area: 73.83Molecular Species: BASEHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.79CX LogP: 1.80CX LogD: 0.40
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.56Np Likeness Score: -1.06

References

1. Lare MS, Smith LH..  (1982)  Beta-adrenergic blocking agents. 22. 1-Phenoxy-3-[[(substituted-amido) alkyl]amino]-2-propanols.,  25  (11): [PMID:6128420] [10.1021/jm00353a004]

Source