3-Amino-N-[2-(2-hydroxy-3-phenoxy-propylamino)-ethyl]-4-methyl-5-nitro-benzenesulfonamide; compound with oxalic acid

ID: ALA3392270

PubChem CID: 13030965

Max Phase: Preclinical

Molecular Formula: C20H26N4O10S

Molecular Weight: 424.48

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1c(N)cc(S(=O)(=O)NCCNCC(O)COc2ccccc2)cc1[N+](=O)[O-].O=C(O)C(=O)O

Standard InChI:  InChI=1S/C18H24N4O6S.C2H2O4/c1-13-17(19)9-16(10-18(13)22(24)25)29(26,27)21-8-7-20-11-14(23)12-28-15-5-3-2-4-6-15;3-1(4)2(5)6/h2-6,9-10,14,20-21,23H,7-8,11-12,19H2,1H3;(H,3,4)(H,5,6)

Standard InChI Key:  FWSKUBLWXQXZJZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 35  0  0  0  0  0  0  0  0999 V2000
    5.1268   -7.5429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9518   -7.5429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3643   -8.2573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3643   -6.8284    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7143   -6.8284    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7143   -8.2573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8750   -4.3792    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.2750   -1.9042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2875   -2.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5875   -3.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5750   -3.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0125   -3.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0125   -3.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3042   -4.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8750   -3.5542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5875   -4.8042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9875   -1.4792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1625   -4.7917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5542   -1.4917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7375   -4.3667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1625   -4.3667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5875   -4.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8750   -4.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4500   -4.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0167   -4.3792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4417   -4.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7167   -2.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5917   -3.5417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3000   -4.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7292   -4.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7292   -4.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4417   -5.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0250   -4.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7292   -6.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0250   -5.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  1  5  2  0
  1  6  1  0
  8  9  1  0
  9 11  2  0
 10  7  1  0
 11 10  1  0
 12  9  1  0
 13 14  1  0
 14 10  2  0
 15  7  2  0
 16  7  2  0
 17  8  1  0
 18  7  1  0
 19  8  2  0
 20 13  1  0
 21 23  1  0
 22 29  1  0
 23 22  1  0
 24 18  1  0
 25 30  1  0
 26 21  1  0
 27 12  1  0
 28 22  1  0
 29 25  1  0
 30 24  1  0
 31 26  1  0
 32 26  2  0
 33 31  2  0
 34 32  1  0
 35 34  2  0
 12 13  2  0
 35 33  1  0
M  CHG  2   8   1  17  -1
M  END

Associated Targets(Human)

ADRB1 Tclin Adrenergic receptor beta (1214 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 424.48Molecular Weight (Monoisotopic): 424.1417AlogP: 0.79#Rotatable Bonds: 11
Polar Surface Area: 156.82Molecular Species: NEUTRALHBA: 8HBD: 4
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 9.83CX Basic pKa: 8.31CX LogP: 0.94CX LogD: 0.11
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.18Np Likeness Score: -1.35

References

1. Lare MS, Smith LH..  (1982)  Beta-adrenergic blocking agents. 22. 1-Phenoxy-3-[[(substituted-amido) alkyl]amino]-2-propanols.,  25  (11): [PMID:6128420] [10.1021/jm00353a004]

Source