The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Amino-N-[2-(2-hydroxy-3-phenoxy-propylamino)-ethyl]-4-methyl-5-nitro-benzenesulfonamide; compound with oxalic acid ID: ALA3392270
PubChem CID: 13030965
Max Phase: Preclinical
Molecular Formula: C20H26N4O10S
Molecular Weight: 424.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(N)cc(S(=O)(=O)NCCNCC(O)COc2ccccc2)cc1[N+](=O)[O-].O=C(O)C(=O)O
Standard InChI: InChI=1S/C18H24N4O6S.C2H2O4/c1-13-17(19)9-16(10-18(13)22(24)25)29(26,27)21-8-7-20-11-14(23)12-28-15-5-3-2-4-6-15;3-1(4)2(5)6/h2-6,9-10,14,20-21,23H,7-8,11-12,19H2,1H3;(H,3,4)(H,5,6)
Standard InChI Key: FWSKUBLWXQXZJZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 35 0 0 0 0 0 0 0 0999 V2000
5.1268 -7.5429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9518 -7.5429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3643 -8.2573 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3643 -6.8284 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7143 -6.8284 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7143 -8.2573 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8750 -4.3792 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.2750 -1.9042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2875 -2.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5875 -3.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5750 -3.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0125 -3.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0125 -3.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3042 -4.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8750 -3.5542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5875 -4.8042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9875 -1.4792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1625 -4.7917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5542 -1.4917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7375 -4.3667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1625 -4.3667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5875 -4.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8750 -4.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4500 -4.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0167 -4.3792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4417 -4.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7167 -2.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5917 -3.5417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3000 -4.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7292 -4.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7292 -4.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4417 -5.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0250 -4.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7292 -6.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0250 -5.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
1 5 2 0
1 6 1 0
8 9 1 0
9 11 2 0
10 7 1 0
11 10 1 0
12 9 1 0
13 14 1 0
14 10 2 0
15 7 2 0
16 7 2 0
17 8 1 0
18 7 1 0
19 8 2 0
20 13 1 0
21 23 1 0
22 29 1 0
23 22 1 0
24 18 1 0
25 30 1 0
26 21 1 0
27 12 1 0
28 22 1 0
29 25 1 0
30 24 1 0
31 26 1 0
32 26 2 0
33 31 2 0
34 32 1 0
35 34 2 0
12 13 2 0
35 33 1 0
M CHG 2 8 1 17 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 424.48Molecular Weight (Monoisotopic): 424.1417AlogP: 0.79#Rotatable Bonds: 11Polar Surface Area: 156.82Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.83CX Basic pKa: 8.31CX LogP: 0.94CX LogD: 0.11Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.18Np Likeness Score: -1.35
References 1. Lare MS, Smith LH.. (1982) Beta-adrenergic blocking agents. 22. 1-Phenoxy-3-[[(substituted-amido) alkyl]amino]-2-propanols., 25 (11): [PMID:6128420 ] [10.1021/jm00353a004 ]