N-[2-(2-Hydroxy-3-phenoxy-propylamino)-ethyl]-2-phenoxy-acetamide; compound with oxalic acid hydrate

ID: ALA3392271

PubChem CID: 118725275

Max Phase: Preclinical

Molecular Formula: C21H28N2O9

Molecular Weight: 344.41

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O.O=C(COc1ccccc1)NCCNCC(O)COc1ccccc1.O=C(O)C(=O)O

Standard InChI:  InChI=1S/C19H24N2O4.C2H2O4.H2O/c22-16(14-24-17-7-3-1-4-8-17)13-20-11-12-21-19(23)15-25-18-9-5-2-6-10-18;3-1(4)2(5)6;/h1-10,16,20,22H,11-15H2,(H,21,23);(H,3,4)(H,5,6);1H2

Standard InChI Key:  VAAJLKZRDKOIRY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 31  0  0  0  0  0  0  0  0999 V2000
    8.6920   -6.5705    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8955   -3.4070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8955   -2.5803    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1816   -3.8204    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3235   -3.4113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1712   -3.3862    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6095   -3.8246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5991   -3.3945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8852   -3.8079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0271   -3.3987    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4447   -3.7996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0375   -3.8246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5991   -2.5595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3131   -3.8121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4676   -3.3987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7411   -3.8121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4447   -4.6263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7307   -3.3820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0375   -4.6513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7514   -3.4113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7307   -5.0354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7514   -5.0647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4654   -3.8246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0293   -3.7996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0293   -4.6263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4654   -4.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1250   -7.0714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9500   -7.0714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3625   -7.7859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3625   -6.3570    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7125   -6.3570    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7125   -7.7859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  4  2  1  0
  5  7  1  0
  6  9  1  0
  7  2  1  0
  8 14  1  0
  9  8  1  0
 10 16  1  0
 11  6  1  0
 12  5  1  0
 13  8  1  0
 14 10  1  0
 15  4  1  0
 16 15  1  0
 17 11  2  0
 18 11  1  0
 19 12  2  0
 20 12  1  0
 21 17  1  0
 22 19  1  0
 23 20  2  0
 24 18  2  0
 25 24  1  0
 26 23  1  0
 26 22  2  0
 21 25  2  0
 27 28  1  0
 28 29  1  0
 28 30  2  0
 27 31  2  0
 27 32  1  0
M  END

Associated Targets(Human)

ADRB1 Tclin Adrenergic receptor beta (1214 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 344.41Molecular Weight (Monoisotopic): 344.1736AlogP: 1.21#Rotatable Bonds: 11
Polar Surface Area: 79.82Molecular Species: BASEHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.79CX LogP: 1.36CX LogD: -0.04
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.53Np Likeness Score: -0.89

References

1. Lare MS, Smith LH..  (1982)  Beta-adrenergic blocking agents. 22. 1-Phenoxy-3-[[(substituted-amido) alkyl]amino]-2-propanols.,  25  (11): [PMID:6128420] [10.1021/jm00353a004]

Source