The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[2-(2-Hydroxy-3-phenoxy-propylamino)-ethyl]-2-phenoxy-acetamide; compound with oxalic acid hydrate ID: ALA3392271
PubChem CID: 118725275
Max Phase: Preclinical
Molecular Formula: C21H28N2O9
Molecular Weight: 344.41
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O.O=C(COc1ccccc1)NCCNCC(O)COc1ccccc1.O=C(O)C(=O)O
Standard InChI: InChI=1S/C19H24N2O4.C2H2O4.H2O/c22-16(14-24-17-7-3-1-4-8-17)13-20-11-12-21-19(23)15-25-18-9-5-2-6-10-18;3-1(4)2(5)6;/h1-10,16,20,22H,11-15H2,(H,21,23);(H,3,4)(H,5,6);1H2
Standard InChI Key: VAAJLKZRDKOIRY-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 31 0 0 0 0 0 0 0 0999 V2000
8.6920 -6.5705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8955 -3.4070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8955 -2.5803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1816 -3.8204 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3235 -3.4113 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1712 -3.3862 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6095 -3.8246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5991 -3.3945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8852 -3.8079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0271 -3.3987 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4447 -3.7996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0375 -3.8246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5991 -2.5595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3131 -3.8121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4676 -3.3987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7411 -3.8121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4447 -4.6263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7307 -3.3820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0375 -4.6513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7514 -3.4113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7307 -5.0354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7514 -5.0647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4654 -3.8246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0293 -3.7996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0293 -4.6263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4654 -4.6596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1250 -7.0714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9500 -7.0714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3625 -7.7859 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3625 -6.3570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7125 -6.3570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7125 -7.7859 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3 2 2 0
4 2 1 0
5 7 1 0
6 9 1 0
7 2 1 0
8 14 1 0
9 8 1 0
10 16 1 0
11 6 1 0
12 5 1 0
13 8 1 0
14 10 1 0
15 4 1 0
16 15 1 0
17 11 2 0
18 11 1 0
19 12 2 0
20 12 1 0
21 17 1 0
22 19 1 0
23 20 2 0
24 18 2 0
25 24 1 0
26 23 1 0
26 22 2 0
21 25 2 0
27 28 1 0
28 29 1 0
28 30 2 0
27 31 2 0
27 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 344.41Molecular Weight (Monoisotopic): 344.1736AlogP: 1.21#Rotatable Bonds: 11Polar Surface Area: 79.82Molecular Species: BASEHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.79CX LogP: 1.36CX LogD: -0.04Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.53Np Likeness Score: -0.89
References 1. Lare MS, Smith LH.. (1982) Beta-adrenergic blocking agents. 22. 1-Phenoxy-3-[[(substituted-amido) alkyl]amino]-2-propanols., 25 (11): [PMID:6128420 ] [10.1021/jm00353a004 ]