[2-(2-Hydroxy-3-phenoxy-propylamino)-ethyl]-carbamic acid 1-(4-chloro-phenyl)-1-methyl-ethyl ester; compound with oxalic acid hydrate

ID: ALA3392273

PubChem CID: 118725276

Max Phase: Preclinical

Molecular Formula: C23H29ClN2O8

Molecular Weight: 406.91

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(OC(=O)NCCNCC(O)COc1ccccc1)c1ccc(Cl)cc1.O=C(O)C(=O)O

Standard InChI:  InChI=1S/C21H27ClN2O4.C2H2O4/c1-21(2,16-8-10-17(22)11-9-16)28-20(26)24-13-12-23-14-18(25)15-27-19-6-4-3-5-7-19;3-1(4)2(5)6/h3-11,18,23,25H,12-15H2,1-2H3,(H,24,26);(H,3,4)(H,5,6)

Standard InChI Key:  NZBIIVZOTHWYPH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 34  0  0  0  0  0  0  0  0999 V2000
    5.6277   -7.5134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4527   -7.5134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8652   -8.2279    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8652   -6.7989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2152   -6.7989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2152   -8.2279    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5875   -4.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0167   -4.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3000   -4.8500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0167   -3.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5875   -3.6125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8750   -4.8500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7375   -3.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3042   -3.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8750   -4.4167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0167   -1.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3000   -4.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5875   -4.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3042   -2.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7375   -2.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7292   -4.4250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0167   -1.1417    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.1542   -4.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3042   -3.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7292   -4.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2250   -5.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0125   -4.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1625   -4.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4417   -4.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1542   -5.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4417   -4.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4417   -6.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7375   -4.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7375   -5.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  1  5  2  0
  1  6  1  0
  8  9  1  0
  9  7  1  0
 10  8  1  0
 11  7  2  0
 12  7  1  0
 13 10  2  0
 14 10  1  0
 15 18  1  0
 16 19  1  0
 17 27  1  0
 18 17  1  0
 19 14  2  0
 20 13  1  0
 21 29  1  0
 22 16  1  0
 23 15  1  0
 24 17  1  0
 25  8  1  0
 26  8  1  0
 27 21  1  0
 28 12  1  0
 29 28  1  0
 30 23  2  0
 31 23  1  0
 32 30  1  0
 33 31  2  0
 34 33  1  0
 16 20  2  0
 32 34  2  0
M  END

Associated Targets(Human)

ADRB1 Tclin Adrenergic receptor beta (1214 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 406.91Molecular Weight (Monoisotopic): 406.1659AlogP: 3.33#Rotatable Bonds: 10
Polar Surface Area: 79.82Molecular Species: BASEHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.96CX Basic pKa: 8.79CX LogP: 3.49CX LogD: 2.09
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.53Np Likeness Score: -0.68

References

1. Lare MS, Smith LH..  (1982)  Beta-adrenergic blocking agents. 22. 1-Phenoxy-3-[[(substituted-amido) alkyl]amino]-2-propanols.,  25  (11): [PMID:6128420] [10.1021/jm00353a004]

Source