The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3,4-Dihydroxy-N-[2-(2-hydroxy-3-phenoxy-propylamino)-ethyl]-benzamide; compound with oxalic acid ID: ALA3392274
PubChem CID: 118725277
Max Phase: Preclinical
Molecular Formula: C20H24N2O9
Molecular Weight: 346.38
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCCNCC(O)COc1ccccc1)c1ccc(O)c(O)c1.O=C(O)C(=O)O
Standard InChI: InChI=1S/C18H22N2O5.C2H2O4/c21-14(12-25-15-4-2-1-3-5-15)11-19-8-9-20-18(24)13-6-7-16(22)17(23)10-13;3-1(4)2(5)6/h1-7,10,14,19,21-23H,8-9,11-12H2,(H,20,24);(H,3,4)(H,5,6)
Standard InChI Key: BFSJQJAEXNEJCO-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 31 0 0 0 0 0 0 0 0999 V2000
4.2723 -6.7473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0973 -6.7473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5098 -7.4618 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5098 -6.0329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8598 -6.0329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8598 -7.4618 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8863 -3.3340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5998 -3.7471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3133 -3.3340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0268 -3.7554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0268 -4.5857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8863 -2.5078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5915 -4.5732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3050 -4.9863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1727 -3.7471 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1656 -3.3172 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5926 -3.3214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7445 -3.3465 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8791 -3.7345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0239 -3.3214 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7403 -4.9988 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4438 -3.7303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5968 -2.4953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3061 -3.7345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4592 -3.3298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7374 -3.7428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7302 -3.3089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4438 -4.5565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0250 -3.7303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7302 -4.9613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0250 -4.5565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
1 5 2 0
1 6 1 0
8 7 1 0
9 8 2 0
10 9 1 0
11 10 2 0
12 7 2 0
13 8 1 0
14 13 2 0
15 7 1 0
16 19 1 0
17 24 1 0
18 10 1 0
19 17 1 0
20 26 1 0
21 11 1 0
22 16 1 0
23 17 1 0
24 20 1 0
25 15 1 0
26 25 1 0
27 22 1 0
28 22 2 0
29 27 2 0
30 28 1 0
31 30 2 0
11 14 1 0
31 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 346.38Molecular Weight (Monoisotopic): 346.1529AlogP: 0.86#Rotatable Bonds: 9Polar Surface Area: 111.05Molecular Species: NEUTRALHBA: 6HBD: 5#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.95CX Basic pKa: 8.29CX LogP: 0.31CX LogD: -0.28Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.34Np Likeness Score: -0.44
References 1. Lare MS, Smith LH.. (1982) Beta-adrenergic blocking agents. 22. 1-Phenoxy-3-[[(substituted-amido) alkyl]amino]-2-propanols., 25 (11): [PMID:6128420 ] [10.1021/jm00353a004 ]