SID87915634

ID: ALA3392470

PubChem CID: 8514638

Max Phase: Preclinical

Molecular Formula: C21H18N2O3S

Molecular Weight: 378.45

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1CCc2cc(S(=O)(=O)Nc3ccccc3-c3ccccc3)ccc2N1

Standard InChI:  InChI=1S/C21H18N2O3S/c24-21-13-10-16-14-17(11-12-19(16)22-21)27(25,26)23-20-9-5-4-8-18(20)15-6-2-1-3-7-15/h1-9,11-12,14,23H,10,13H2,(H,22,24)

Standard InChI Key:  PFFYFTUTHAVQCU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 30  0  0  1  0  0  0  0  0999 V2000
    2.2246    1.5929    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.9390    1.1804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5100    2.0054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5745   -2.6940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6371    2.3074    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5745   -1.2650    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8120    0.8784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8120   -0.5505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4621    2.3074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9870   -0.5505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2245    0.1639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8746    3.0218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9870    0.8784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5745    0.1639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4621    3.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2245   -1.2650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8746    1.5929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9870   -1.9796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6996    3.0218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8120   -1.9796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6996    1.5929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1121    2.3074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6371    3.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8746    4.4509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2246    4.4509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4621    5.1653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6371    5.1653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  3  2  0
  1  5  1  0
  1  7  1  0
  4 18  2  0
  5  9  1  0
  6 10  1  0
  6 18  1  0
  7 11  2  0
  7 13  1  0
  8 10  2  0
  8 11  1  0
  8 16  1  0
  9 12  2  0
  9 17  1  0
 10 14  1  0
 12 15  1  0
 12 19  1  0
 13 14  2  0
 15 23  2  0
 15 24  1  0
 16 20  1  0
 17 21  2  0
 18 20  1  0
 19 22  2  0
 21 22  1  0
 23 25  1  0
 24 26  2  0
 25 27  2  0
 26 27  1  0
M  END

Associated Targets(non-human)

PYK Pyruvate kinase (6726 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 378.45Molecular Weight (Monoisotopic): 378.1038AlogP: 4.04#Rotatable Bonds: 4
Polar Surface Area: 75.27Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.63CX Basic pKa: CX LogP: 3.65CX LogD: 3.48
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.72Np Likeness Score: -1.32

References

1. PubChem BioAssay data set, 

Source

Source(1):