The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID50112160 ID: ALA3392566
PubChem CID: 24868060
Max Phase: Preclinical
Molecular Formula: C26H26N2O4S
Molecular Weight: 462.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=C1CCN(C(Cc2ccccc2)C(=O)Nc2ccc(OC)cc2)S(=O)(=O)c2ccccc21
Standard InChI: InChI=1S/C26H26N2O4S/c1-19-16-17-28(33(30,31)25-11-7-6-10-23(19)25)24(18-20-8-4-3-5-9-20)26(29)27-21-12-14-22(32-2)15-13-21/h3-15,24H,1,16-18H2,2H3,(H,27,29)
Standard InChI Key: VVTDYXPQQUPOMG-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 1 0 0 0 0 0999 V2000
2.2704 1.1562 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.8752 1.7173 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8579 1.8706 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3810 -0.1337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9534 -0.5464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9521 0.6914 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0955 1.1038 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4821 0.9130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1806 0.1451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6666 1.1039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5931 -0.5695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0136 -0.1313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9677 1.5581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3810 0.6913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4089 -0.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3648 0.0221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6666 1.9289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1518 1.4352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1496 0.6672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3811 2.3414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1283 -1.2511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8100 0.6913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3811 3.1664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0955 1.9288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5245 1.1038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8099 -0.1338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2390 -0.1338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2390 0.6912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5244 -0.5463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0956 3.5788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8100 2.3413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8101 3.1663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6679 -0.1339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 3 2 0
1 6 1 0
1 8 1 0
4 14 2 0
5 27 1 0
5 33 1 0
6 10 1 0
6 12 1 0
7 14 1 0
7 22 1 0
8 9 1 0
8 13 2 0
9 11 1 0
9 16 2 0
10 14 1 0
10 17 1 0
11 15 1 0
11 21 2 0
12 15 1 0
13 18 1 0
16 19 1 0
17 20 1 0
18 19 2 0
20 23 2 0
20 24 1 0
22 25 2 0
22 26 1 0
23 30 1 0
24 31 2 0
25 28 1 0
26 29 2 0
27 28 2 0
27 29 1 0
30 32 2 0
31 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.57Molecular Weight (Monoisotopic): 462.1613AlogP: 4.35#Rotatable Bonds: 6Polar Surface Area: 75.71Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.62CX Basic pKa: ┄CX LogP: 4.57CX LogD: 4.57Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.59Np Likeness Score: -0.65
References 1. PubChem BioAssay data set,