The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID104224765 ID: ALA3392632
PubChem CID: 49852989
Max Phase: Preclinical
Molecular Formula: C17H23N7O2S2
Molecular Weight: 421.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C)nc(NC(=S)N2CCN(c3ccc(NS(C)(=O)=O)nn3)CC2)c1
Standard InChI: InChI=1S/C17H23N7O2S2/c1-12-10-13(2)18-15(11-12)19-17(27)24-8-6-23(7-9-24)16-5-4-14(20-21-16)22-28(3,25)26/h4-5,10-11H,6-9H2,1-3H3,(H,20,22)(H,18,19,27)
Standard InChI Key: CQCAKFYEQOBSFD-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 1 0 0 0 0 0999 V2000
2.2246 1.5931 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.8260 3.0319 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.9399 1.1802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5094 2.0060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9396 2.3154 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5916 2.3194 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6996 1.6002 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8781 1.5963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8263 1.6066 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6375 2.3084 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0621 0.8910 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1138 2.3154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4144 2.3190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4635 2.3083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3529 1.6041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3528 3.0346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1788 3.0345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1787 1.6041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6996 3.0275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6494 1.6060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8748 3.0252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0624 2.3213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8880 0.8910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8879 2.3214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3009 1.6063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8117 0.8779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3000 0.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2995 3.0343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 3 2 0
1 4 2 0
1 10 1 0
1 26 1 0
2 13 2 0
5 12 1 0
5 15 1 0
5 16 1 0
6 13 1 0
6 17 1 0
6 18 1 0
7 8 1 0
7 12 2 0
8 14 2 0
9 13 1 0
9 20 1 0
10 14 1 0
11 20 2 0
11 23 1 0
12 19 1 0
14 21 1 0
15 18 1 0
16 17 1 0
19 21 2 0
20 22 1 0
22 24 2 0
23 25 2 0
23 27 1 0
24 25 1 0
24 28 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 421.55Molecular Weight (Monoisotopic): 421.1355AlogP: 1.38#Rotatable Bonds: 4Polar Surface Area: 103.35Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.62CX Basic pKa: 4.48CX LogP: 1.34CX LogD: 1.16Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.71Np Likeness Score: -2.21
References 1. PubChem BioAssay data set,