SID124949473

ID: ALA3392641

PubChem CID: 42397489

Max Phase: Preclinical

Molecular Formula: C23H28N4O4S

Molecular Weight: 456.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCn1c(C)nc2cc(NS(=O)(=O)c3ccccc3)cc(C(=O)N3C[C@@H](C)O[C@@H](C)C3)c21

Standard InChI:  InChI=1S/C23H28N4O4S/c1-5-27-17(4)24-21-12-18(25-32(29,30)19-9-7-6-8-10-19)11-20(22(21)27)23(28)26-13-15(2)31-16(3)14-26/h6-12,15-16,25H,5,13-14H2,1-4H3/t15-,16+

Standard InChI Key:  NZIPPIIUQJUEQW-IYBDPMFKSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  1  0  0  0  0  0999 V2000
    2.2243    1.5927    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.2392    5.8783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9377    1.1808    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5110    2.0044    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1208    5.1370    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8409    5.0621    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1774    3.9128    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4723    5.1520    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6361    2.3059    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3949    4.4492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2205    4.4481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9831    3.7359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2188    3.0225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0923    4.7305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6416    5.1609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6306    3.7358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3968    3.0214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0179    5.8678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8125    0.8793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8862    5.8691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8752    4.4439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6211    5.1423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7169    5.8602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7002    4.4336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9905    0.8783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2263    0.1649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4042    6.4189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5725    0.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8108   -0.5464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1416    6.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1191    3.7114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9884   -0.5567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  3  2  0
  1  4  2  0
  1  9  1  0
  1 19  1  0
  2 15  2  0
  5 23  1  0
  5 24  1  0
  6 10  1  0
  6 14  1  0
  6 18  1  0
  7 12  1  0
  7 14  2  0
  8 15  1  0
  8 20  1  0
  8 21  1  0
  9 13  1  0
 10 11  2  0
 10 12  1  0
 11 15  1  0
 11 16  1  0
 12 17  2  0
 13 16  2  0
 13 17  1  0
 14 22  1  0
 18 27  1  0
 19 25  2  0
 19 26  1  0
 20 23  1  0
 21 24  1  0
 23 30  1  6
 24 31  1  6
 25 28  1  0
 26 29  2  0
 28 32  2  0
 29 32  1  0
M  END

Associated Targets(Human)

ATXN2 Tbio Ataxin-2 (54410 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 456.57Molecular Weight (Monoisotopic): 456.1831AlogP: 3.41#Rotatable Bonds: 5
Polar Surface Area: 93.53Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.57CX Basic pKa: 5.72CX LogP: 2.25CX LogD: 2.16
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.64Np Likeness Score: -1.85

References

1. PubChem BioAssay data set, 

Source

Source(1):