The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID104224795 ID: ALA3392644
PubChem CID: 49853085
Max Phase: Preclinical
Molecular Formula: C19H23ClN4O2S2
Molecular Weight: 439.01
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C)nc(NC(=S)N2CCN(c3ccc(Cl)cc3S(C)(=O)=O)CC2)c1
Standard InChI: InChI=1S/C19H23ClN4O2S2/c1-13-10-14(2)21-18(11-13)22-19(27)24-8-6-23(7-9-24)16-5-4-15(20)12-17(16)28(3,25)26/h4-5,10-12H,6-9H2,1-3H3,(H,21,22,27)
Standard InChI Key: DCLLMXAKOMJWDV-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 1 0 0 0 0 0999 V2000
3.3446 -1.0616 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.9150 1.4143 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.6556 2.6518 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.7407 1.4143 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9150 2.2400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4854 0.5886 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9431 1.4173 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3686 1.4173 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.7962 1.4163 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9150 0.5886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2004 0.1758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6295 0.1766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2004 -0.6492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6295 -0.6487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2280 0.1788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4870 1.4173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9156 -1.0616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2280 1.8302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9431 0.5916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6556 1.8291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0812 1.8291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0893 1.4143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0812 2.6548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5113 1.8291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7962 3.0677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5113 2.6548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2236 1.4174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7962 3.8904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 14 1 0
2 4 2 0
2 5 2 0
2 10 1 0
2 22 1 0
3 20 2 0
6 11 1 0
6 15 1 0
6 16 1 0
7 18 1 0
7 19 1 0
7 20 1 0
8 20 1 0
8 21 1 0
9 21 2 0
9 24 1 0
10 11 1 0
10 12 2 0
11 13 2 0
12 14 1 0
13 17 1 0
14 17 2 0
15 19 1 0
16 18 1 0
21 23 1 0
23 25 2 0
24 26 2 0
24 27 1 0
25 26 1 0
25 28 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 439.01Molecular Weight (Monoisotopic): 438.0951AlogP: 3.27#Rotatable Bonds: 3Polar Surface Area: 65.54Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.48CX LogP: 3.42CX LogD: 3.42Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.74Np Likeness Score: -2.05
References 1. PubChem BioAssay data set,