The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4R)-4-N-[2,6-dimethoxy-4-methyl-5-[3-(trifluoromethyl)phenoxy]quinolin-8-yl]pentane-1,4-diamine ID: ALA3392933
PubChem CID: 76969187
Max Phase: Preclinical
Molecular Formula: C24H28F3N3O3
Molecular Weight: 463.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C)c2c(Oc3cccc(C(F)(F)F)c3)c(OC)cc(N[C@H](C)CCCN)c2n1
Standard InChI: InChI=1S/C24H28F3N3O3/c1-14-11-20(32-4)30-22-18(29-15(2)7-6-10-28)13-19(31-3)23(21(14)22)33-17-9-5-8-16(12-17)24(25,26)27/h5,8-9,11-13,15,29H,6-7,10,28H2,1-4H3/t15-/m1/s1
Standard InChI Key: LBHLFPGPEGDCJG-OAHLLOKOSA-N
Molfile:
RDKit 2D
33 35 0 0 1 0 0 0 0 0999 V2000
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 2.9981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5870 3.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6288 3.1588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5812 5.2552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8775 6.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8717 7.5123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9082 8.1170 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8942 1.4964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9326 0.8949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 -2.9981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5870 -3.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5835 -5.2544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8807 -6.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1815 -5.2608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1852 -3.7608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4868 -3.0136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5249 -3.6154 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-6.4893 -1.8136 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-7.5272 -2.4156 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.8880 -3.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9122 -1.4966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9506 -0.8952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -2.6973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 6
4 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
2 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
12 15 1 0
15 16 2 0
16 17 1 0
10 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
24 29 1 0
20 29 2 0
18 30 1 0
1 30 2 0
30 31 1 0
31 32 1 0
16 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 463.50Molecular Weight (Monoisotopic): 463.2083AlogP: 5.91#Rotatable Bonds: 9Polar Surface Area: 78.63Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.20CX LogP: 4.97CX LogD: 2.37Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.41Np Likeness Score: -0.63
References 1. Kaiser M, Mäser P, Tadoori LP, Ioset JR, Brun R.. Antiprotozoal Activity Profiling of Approved Drugs: A Starting Point toward Drug Repositioning, [10.6019/CHEMBL3392926 ]