The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
((Z)-2-(Hydroxymethyl)-4-(3-methylbutylidene)-5-oxotetrahydrofuran-2-yl)methyl-(9Z,12Z)-octadeca-9,12-dienoate ID: ALA3393654
PubChem CID: 118725578
Max Phase: Preclinical
Molecular Formula: C29H48O5
Molecular Weight: 476.70
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCC/C=C/C/C=C/CCCCCCCC(=O)OCC1(CO)C/C(=C/CC(C)C)C(=O)O1
Standard InChI: InChI=1S/C29H48O5/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-27(31)33-24-29(23-30)22-26(28(32)34-29)21-20-25(2)3/h8-9,11-12,21,25,30H,4-7,10,13-20,22-24H2,1-3H3/b9-8+,12-11+,26-21-
Standard InChI Key: JFAIQUNDRVEIFN-UIDAQTEXSA-N
Molfile:
RDKit 2D
34 34 0 0 0 0 0 0 0 0999 V2000
0.6962 4.3269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4187 5.3315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1070 6.7996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2219 7.8043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9102 9.2724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0252 10.2771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7135 11.7452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8284 12.7499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5167 14.2180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6316 15.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3199 16.6908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4348 17.6955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1231 19.1636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2381 20.1683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9264 21.6364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0413 22.6411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7296 24.1092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.6210 24.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8375 4.6976 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3845 2.8588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.0323 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.2760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4553 -2.0031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6375 0.8602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7555 -0.1410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1819 0.3258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0759 -0.4748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4286 1.5001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3033 -0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4448 -0.2487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4995 1.8541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
1 19 2 0
1 20 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
21 25 1 0
25 26 2 0
27 28 1 0
28 29 1 0
29 30 1 0
29 31 1 0
24 27 2 0
32 33 1 0
22 32 1 0
22 34 1 0
34 20 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 476.70Molecular Weight (Monoisotopic): 476.3502AlogP: 6.99#Rotatable Bonds: 19Polar Surface Area: 72.83Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 8.09CX LogD: 8.09Aromatic Rings: ┄Heavy Atoms: 34QED Weighted: 0.09Np Likeness Score: 1.54
References 1. Ann J, Yoon S, Baek J, Kim DH, Lewin NE, Hill CS, Blumberg PM, Lee J.. (2015) Design and synthesis of protein kinase C epsilon selective diacylglycerol lactones (DAG-lactones)., 90 [PMID:25437619 ] [10.1016/j.ejmech.2014.11.025 ]