((Z)-2-(Hydroxymethyl)-4-(3-methylbutylidene)-5-oxotetrahydrofuran-2-yl)methyl-(9Z,12Z)-octadeca-9,12-dienoate

ID: ALA3393654

PubChem CID: 118725578

Max Phase: Preclinical

Molecular Formula: C29H48O5

Molecular Weight: 476.70

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCC/C=C/C/C=C/CCCCCCCC(=O)OCC1(CO)C/C(=C/CC(C)C)C(=O)O1

Standard InChI:  InChI=1S/C29H48O5/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-27(31)33-24-29(23-30)22-26(28(32)34-29)21-20-25(2)3/h8-9,11-12,21,25,30H,4-7,10,13-20,22-24H2,1-3H3/b9-8+,12-11+,26-21-

Standard InChI Key:  JFAIQUNDRVEIFN-UIDAQTEXSA-N

Molfile:  

     RDKit          2D

 34 34  0  0  0  0  0  0  0  0999 V2000
    0.6962    4.3269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4187    5.3315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1070    6.7996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2219    7.8043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9102    9.2724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0252   10.2771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7135   11.7452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8284   12.7499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5167   14.2180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6316   15.2227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3199   16.6908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4348   17.6955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1231   19.1636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2381   20.1683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9264   21.6364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0413   22.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7296   24.1092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6210   24.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8375    4.6976    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3845    2.8588    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.0323    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2135    0.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2135    0.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.0323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4553   -2.0031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6375    0.8602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7555   -0.1410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1819    0.3258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0759   -0.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4286    1.5001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3033   -0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4448   -0.2487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4995    1.8541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
  1 19  2  0
  1 20  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 21 25  1  0
 25 26  2  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 29 31  1  0
 24 27  2  0
 32 33  1  0
 22 32  1  0
 22 34  1  0
 34 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3393654

    ---

Associated Targets(Human)

PRKCE Tchem Protein kinase C epsilon (1520 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PRKCA Tchem Protein kinase C alpha (5923 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 476.70Molecular Weight (Monoisotopic): 476.3502AlogP: 6.99#Rotatable Bonds: 19
Polar Surface Area: 72.83Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 8.09CX LogD: 8.09
Aromatic Rings: Heavy Atoms: 34QED Weighted: 0.09Np Likeness Score: 1.54

References

1. Ann J, Yoon S, Baek J, Kim DH, Lewin NE, Hill CS, Blumberg PM, Lee J..  (2015)  Design and synthesis of protein kinase C epsilon selective diacylglycerol lactones (DAG-lactones).,  90  [PMID:25437619] [10.1016/j.ejmech.2014.11.025]

Source