The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((S)-2-Methyl-1,4-dioxa-8-aza-spiro[4.5]dec-8-yl)-8-nitro-1-oxo-6-trifluoromethyl-benzo[e][1,3]thiazin-4-one ID: ALA3394191
PubChem CID: 102004363
Max Phase: Preclinical
Molecular Formula: C17H16F3N3O6S
Molecular Weight: 447.39
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H]1COC2(CCN(c3nc(=O)c4cc(C(F)(F)F)cc([N+](=O)[O-])c4[s+]3[O-])CC2)O1
Standard InChI: InChI=1S/C17H16F3N3O6S/c1-9-8-28-16(29-9)2-4-22(5-3-16)15-21-14(24)11-6-10(17(18,19)20)7-12(23(25)26)13(11)30(15)27/h6-7,9H,2-5,8H2,1H3/t9-,30?/m0/s1
Standard InChI Key: UJFVBUUVNCGPRL-XDYOZPDLSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
0.0186 0.7828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8574 -0.4287 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0186 -1.6401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4351 -1.1556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4351 0.3168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6351 10.0554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2655 10.6605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9506 9.7606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7885 8.5503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5797 7.6670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7898 8.2722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9985 7.3889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8377 5.9005 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4679 5.2953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7405 6.1786 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.0962 7.8739 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1590 7.9384 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.1310 8.6421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2827 6.7448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1042 12.1525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0725 12.8613 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.9937 12.6370 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.0253 13.3455 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.3168 3.8022 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5656 2.8889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3979 1.3979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1742 1.6588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0251 3.1871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4114 -1.8534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8382 5.6937 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
6 7 2 0
7 8 1 0
8 11 2 0
10 9 2 0
9 6 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 10 1 0
12 16 2 0
17 18 2 0
17 19 1 0
9 17 1 0
7 20 1 0
20 21 1 0
20 22 1 0
20 23 1 0
14 24 1 0
24 25 1 0
24 28 1 0
25 26 1 0
26 1 1 0
1 27 1 0
27 28 1 0
4 29 1 1
15 30 1 0
M CHG 4 15 1 17 1 19 -1 30 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.39Molecular Weight (Monoisotopic): 447.0712AlogP: 2.98#Rotatable Bonds: 2Polar Surface Area: 117.86Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.52CX LogD: 2.52Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.39Np Likeness Score: -0.59
References 1. Tiwari R, Miller PA, Cho S, Franzblau SG, Miller MJ.. (2015) Syntheses and Antituberculosis Activity of 1,3-Benzothiazinone Sulfoxide and Sulfone Derived from BTZ043., 6 (2): [PMID:25699139 ] [10.1021/ml5003458 ]