The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(4-(2-methoxyphenyl)piperazin-1-yl)propyl)-3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazine-6-sulfonamide ID: ALA3397379
PubChem CID: 118726639
Max Phase: Preclinical
Molecular Formula: C22H28N4O5S
Molecular Weight: 460.56
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1N1CCN(CCCNS(=O)(=O)c2ccc3c(c2)NC(=O)CO3)CC1
Standard InChI: InChI=1S/C22H28N4O5S/c1-30-21-6-3-2-5-19(21)26-13-11-25(12-14-26)10-4-9-23-32(28,29)17-7-8-20-18(15-17)24-22(27)16-31-20/h2-3,5-8,15,23H,4,9-14,16H2,1H3,(H,24,27)
Standard InChI Key: GLTGZMMCTMKTIN-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-4.9497 0.8990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9106 1.4992 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-4.9500 2.0989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2097 9.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5076 10.5030 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.8078 9.7550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8100 8.2550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5122 7.5029 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2120 8.2510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5114 6.0021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2118 5.2515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2110 3.7506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9114 3.0001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6321 1.3486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.5053 12.0037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2063 12.7539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2064 14.2539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5054 15.0038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8044 14.2538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8044 12.7538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9049 12.0063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8666 12.6079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 2 1 0
2 14 1 0
14 15 2 0
15 19 1 0
18 16 1 0
16 17 2 0
17 14 1 0
18 19 2 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
21 24 2 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
5 25 1 0
26 31 1 0
31 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.56Molecular Weight (Monoisotopic): 460.1780AlogP: 1.52#Rotatable Bonds: 8Polar Surface Area: 100.21Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.26CX Basic pKa: 6.98CX LogP: 1.24CX LogD: 1.10Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.58Np Likeness Score: -1.71
References 1. Konda S, Raparthi S, Bhaskar K, Munaganti RK, Guguloth V, Nagarapu L, Akkewar DM.. (2015) Synthesis and antimicrobial activity of novel benzoxazine sulfonamide derivatives., 25 (7): [PMID:25754493 ] [10.1016/j.bmcl.2015.01.026 ]